About 3-N-[8-(3-methyl-1-benzofuran-5-yl)quinoxalin-6-yl]-4-methylsulfonylbenzene-1,3-diamine
3-N-[8-(3-methyl-1-benzofuran-5-yl)quinoxalin-6-yl]-4-methylsulfonylbenzene-1,3-diamine (PubChem CID 122690581) has the molecular formula C24H20N4O3S
and a molecular weight of 444.52 g/mol. Its IUPAC name is 3-N-[8-(3-methyl-1-benzofuran-5-yl)quinoxalin-6-yl]-4-methylsulfonylbenzene-1,3-diamine.
Molecular Properties
| Compound Name | 3-N-[8-(3-methyl-1-benzofuran-5-yl)quinoxalin-6-yl]-4-methylsulfonylbenzene-1,3-diamine |
| PubChem CID | 122690581 |
| Molecular Formula | C24H20N4O3S |
| Molecular Weight | 444.52 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | 3-N-[8-(3-methyl-1-benzofuran-5-yl)quinoxalin-6-yl]-4-methylsulfonylbenzene-1,3-diamine |
| SMILES | Cc1coc2ccc(-c3cc(Nc4cc(N)ccc4S(C)(=O)=O)cc4nccnc34)cc12 |
| InChI | InChI=1S/C24H20N4O3S/c1-14-13-31-22-5-3-15(9-18(14)22)19-11-17(12-21-24(19)27-8-7-26-21)28-20-10-16(25)4-6-23(20)32(2,29)30/h3-13,28H,25H2,1-2H3 |
| InChIKey | XRDXIOZGBUOVGG-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 111.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 444.52 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-N-[8-(3-methyl-1-benzofuran-5-yl)quinoxalin-6-yl]-4-methylsulfonylbenzene-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-N-[8-(3-methyl-1-benzofuran-5-yl)quinoxalin-6-yl]-4-methylsulfonylbenzene-1,3-diamine?
The IUPAC name of 3-N-[8-(3-methyl-1-benzofuran-5-yl)quinoxalin-6-yl]-4-methylsulfonylbenzene-1,3-diamine (CID 122690581) is 3-N-[8-(3-methyl-1-benzofuran-5-yl)quinoxalin-6-yl]-4-methylsulfonylbenzene-1,3-diamine.
What is the SMILES notation for 3-N-[8-(3-methyl-1-benzofuran-5-yl)quinoxalin-6-yl]-4-methylsulfonylbenzene-1,3-diamine?
The canonical SMILES for 3-N-[8-(3-methyl-1-benzofuran-5-yl)quinoxalin-6-yl]-4-methylsulfonylbenzene-1,3-diamine is Cc1coc2ccc(-c3cc(Nc4cc(N)ccc4S(C)(=O)=O)cc4nccnc34)cc12.
What is the InChIKey of 3-N-[8-(3-methyl-1-benzofuran-5-yl)quinoxalin-6-yl]-4-methylsulfonylbenzene-1,3-diamine?
The InChIKey is XRDXIOZGBUOVGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H20N4O3S/c1-14-13-31-22-5-3-15(9-18(14)22)19-11-17(12-21-24(19)27-8-7-26-21)28-20-10-16(25)4-6-23(20)32(2,29)30/h3-13,28H,25H2,1-2H3.
What are the key properties of 3-N-[8-(3-methyl-1-benzofuran-5-yl)quinoxalin-6-yl]-4-methylsulfonylbenzene-1,3-diamine?
3-N-[8-(3-methyl-1-benzofuran-5-yl)quinoxalin-6-yl]-4-methylsulfonylbenzene-1,3-diamine has a molecular weight of 444.52 g/mol, XLogP of 5.08, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-N-[8-(3-methyl-1-benzofuran-5-yl)quinoxalin-6-yl]-4-methylsulfonylbenzene-1,3-diamine is sourced from PubChem (CID 122690581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).