C28H25N7O2 — CID 122690708
3-[[8-(1-methylindol-6-yl)quinoxalin-6-yl]amino]-N-(2-oxopiperidin-4-yl)pyridine-4-carboxamide (PubChem CID 122690708) has the molecular formula C28H25N7O2 and a molecular weight of 491.56 g/mol. Its IUPAC name is 3-[[8-(1-methylindol-6-yl)quinoxalin-6-yl]amino]-N-(2-oxopiperidin-4-yl)pyridine-4-carboxamide.
| Compound Name | 3-[[8-(1-methylindol-6-yl)quinoxalin-6-yl]amino]-N-(2-oxopiperidin-4-yl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 122690708 |
| Molecular Formula | C28H25N7O2 |
| Molecular Weight | 491.56 g/mol |
| Exact Mass | 491.21 |
| IUPAC Name | 3-[[8-(1-methylindol-6-yl)quinoxalin-6-yl]amino]-N-(2-oxopiperidin-4-yl)pyridine-4-carboxamide |
| SMILES | Cn1ccc2ccc(-c3cc(Nc4cnccc4C(=O)NC4CCNC(=O)C4)cc4nccnc34)cc21 |
| InChI | InChI=1S/C28H25N7O2/c1-35-11-6-17-2-3-18(12-25(17)35)22-13-20(14-23-27(22)32-10-9-30-23)33-24-16-29-7-5-21(24)28(37)34-19-4-8-31-26(36)15-19/h2-3,5-7,9-14,16,19,33H,4,8,15H2,1H3,(H,31,36)(H,34,37) |
| InChIKey | XGCRBZXEACAZHB-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 113.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.56 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|