About 8-(2,1,3-benzothiadiazol-5-yl)quinoxalin-6-amine
8-(2,1,3-benzothiadiazol-5-yl)quinoxalin-6-amine (PubChem CID 122690728) has the molecular formula C14H9N5S
and a molecular weight of 279.33 g/mol. Its IUPAC name is 8-(2,1,3-benzothiadiazol-5-yl)quinoxalin-6-amine.
Molecular Properties
| Compound Name | 8-(2,1,3-benzothiadiazol-5-yl)quinoxalin-6-amine |
| PubChem CID | 122690728 |
| Molecular Formula | C14H9N5S |
| Molecular Weight | 279.33 g/mol |
| Exact Mass | 279.06 |
| IUPAC Name | 8-(2,1,3-benzothiadiazol-5-yl)quinoxalin-6-amine |
| SMILES | Nc1cc(-c2ccc3nsnc3c2)c2nccnc2c1 |
| InChI | InChI=1S/C14H9N5S/c15-9-6-10(14-13(7-9)16-3-4-17-14)8-1-2-11-12(5-8)19-20-18-11/h1-7H,15H2 |
| InChIKey | TYIUQSAZSCUNHU-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 77.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.33 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 8-(2,1,3-benzothiadiazol-5-yl)quinoxalin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(2,1,3-benzothiadiazol-5-yl)quinoxalin-6-amine?
The IUPAC name of 8-(2,1,3-benzothiadiazol-5-yl)quinoxalin-6-amine (CID 122690728) is 8-(2,1,3-benzothiadiazol-5-yl)quinoxalin-6-amine.
What is the SMILES notation for 8-(2,1,3-benzothiadiazol-5-yl)quinoxalin-6-amine?
The canonical SMILES for 8-(2,1,3-benzothiadiazol-5-yl)quinoxalin-6-amine is Nc1cc(-c2ccc3nsnc3c2)c2nccnc2c1.
What is the InChIKey of 8-(2,1,3-benzothiadiazol-5-yl)quinoxalin-6-amine?
The InChIKey is TYIUQSAZSCUNHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9N5S/c15-9-6-10(14-13(7-9)16-3-4-17-14)8-1-2-11-12(5-8)19-20-18-11/h1-7H,15H2.
What are the key properties of 8-(2,1,3-benzothiadiazol-5-yl)quinoxalin-6-amine?
8-(2,1,3-benzothiadiazol-5-yl)quinoxalin-6-amine has a molecular weight of 279.33 g/mol, XLogP of 2.88, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(2,1,3-benzothiadiazol-5-yl)quinoxalin-6-amine is sourced from PubChem (CID 122690728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).