About 4-methylbenzenesulfonate;1,2,5-trimethylpyrazin-1-ium
4-methylbenzenesulfonate;1,2,5-trimethylpyrazin-1-ium (PubChem CID 122691152) has the molecular formula C14H18N2O3S
and a molecular weight of 294.38 g/mol. Its IUPAC name is 4-methylbenzenesulfonate;1,2,5-trimethylpyrazin-1-ium.
Molecular Properties
| Compound Name | 4-methylbenzenesulfonate;1,2,5-trimethylpyrazin-1-ium |
| PubChem CID | 122691152 |
| Molecular Formula | C14H18N2O3S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 4-methylbenzenesulfonate;1,2,5-trimethylpyrazin-1-ium |
| SMILES | Cc1c[n+](C)c(C)cn1.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C7H11N2.C7H8O3S/c1-6-5-9(3)7(2)4-8-6;1-6-2-4-7(5-3-6)11(8,9)10/h4-5H,1-3H3;2-5H,1H3,(H,8,9,10)/q+1;/p-1 |
| InChIKey | IUJWNUTYEQIUNA-UHFFFAOYSA-M |
| XLogP | 1.42 |
| TPSA | 73.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 4-methylbenzenesulfonate;1,2,5-trimethylpyrazin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylbenzenesulfonate;1,2,5-trimethylpyrazin-1-ium?
The IUPAC name of 4-methylbenzenesulfonate;1,2,5-trimethylpyrazin-1-ium (CID 122691152) is 4-methylbenzenesulfonate;1,2,5-trimethylpyrazin-1-ium.
What is the SMILES notation for 4-methylbenzenesulfonate;1,2,5-trimethylpyrazin-1-ium?
The canonical SMILES for 4-methylbenzenesulfonate;1,2,5-trimethylpyrazin-1-ium is Cc1c[n+](C)c(C)cn1.Cc1ccc(S(=O)(=O)[O-])cc1.
What is the InChIKey of 4-methylbenzenesulfonate;1,2,5-trimethylpyrazin-1-ium?
The InChIKey is IUJWNUTYEQIUNA-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H11N2.C7H8O3S/c1-6-5-9(3)7(2)4-8-6;1-6-2-4-7(5-3-6)11(8,9)10/h4-5H,1-3H3;2-5H,1H3,(H,8,9,10)/q+1;/p-1.
What are the key properties of 4-methylbenzenesulfonate;1,2,5-trimethylpyrazin-1-ium?
4-methylbenzenesulfonate;1,2,5-trimethylpyrazin-1-ium has a molecular weight of 294.38 g/mol, XLogP of 1.42, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylbenzenesulfonate;1,2,5-trimethylpyrazin-1-ium is sourced from PubChem (CID 122691152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).