About 1-[2-[4-[6-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-pyridinyl]phenoxy]-5-fluorophenyl]ethanone
1-[2-[4-[6-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-pyridinyl]phenoxy]-5-fluorophenyl]ethanone (PubChem CID 122691301) has the molecular formula C24H22FNO4
and a molecular weight of 407.44 g/mol. Its IUPAC name is 1-[2-[4-[6-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-pyridinyl]phenoxy]-5-fluorophenyl]ethanone.
Molecular Properties
| Compound Name | 1-[2-[4-[6-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-pyridinyl]phenoxy]-5-fluorophenyl]ethanone |
| PubChem CID | 122691301 |
| Molecular Formula | C24H22FNO4 |
| Molecular Weight | 407.44 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | 1-[2-[4-[6-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-pyridinyl]phenoxy]-5-fluorophenyl]ethanone |
| SMILES | CC(=O)c1cc(F)ccc1Oc1ccc(-c2cccc(C3COC(C)(C)O3)n2)cc1 |
| InChI | InChI=1S/C24H22FNO4/c1-15(27)19-13-17(25)9-12-22(19)29-18-10-7-16(8-11-18)20-5-4-6-21(26-20)23-14-28-24(2,3)30-23/h4-13,23H,14H2,1-3H3 |
| InChIKey | IKPBIIFMTDWCNC-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 407.44 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[2-[4-[6-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-pyridinyl]phenoxy]-5-fluorophenyl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-[4-[6-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-pyridinyl]phenoxy]-5-fluorophenyl]ethanone?
The IUPAC name of 1-[2-[4-[6-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-pyridinyl]phenoxy]-5-fluorophenyl]ethanone (CID 122691301) is 1-[2-[4-[6-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-pyridinyl]phenoxy]-5-fluorophenyl]ethanone.
What is the SMILES notation for 1-[2-[4-[6-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-pyridinyl]phenoxy]-5-fluorophenyl]ethanone?
The canonical SMILES for 1-[2-[4-[6-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-pyridinyl]phenoxy]-5-fluorophenyl]ethanone is CC(=O)c1cc(F)ccc1Oc1ccc(-c2cccc(C3COC(C)(C)O3)n2)cc1.
What is the InChIKey of 1-[2-[4-[6-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-pyridinyl]phenoxy]-5-fluorophenyl]ethanone?
The InChIKey is IKPBIIFMTDWCNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H22FNO4/c1-15(27)19-13-17(25)9-12-22(19)29-18-10-7-16(8-11-18)20-5-4-6-21(26-20)23-14-28-24(2,3)30-23/h4-13,23H,14H2,1-3H3.
What are the key properties of 1-[2-[4-[6-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-pyridinyl]phenoxy]-5-fluorophenyl]ethanone?
1-[2-[4-[6-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-pyridinyl]phenoxy]-5-fluorophenyl]ethanone has a molecular weight of 407.44 g/mol, XLogP of 5.71, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-[4-[6-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-pyridinyl]phenoxy]-5-fluorophenyl]ethanone is sourced from PubChem (CID 122691301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).