About 1-O-[3-(2,3-dihydroxypropylsulfanyl)-2-hydroxypropyl] 5-O-(2-ethylhexyl) 4-ethyl-2,2-dimethylpentanedioate
1-O-[3-(2,3-dihydroxypropylsulfanyl)-2-hydroxypropyl] 5-O-(2-ethylhexyl) 4-ethyl-2,2-dimethylpentanedioate (PubChem CID 122691337) has the molecular formula C23H44O7S
and a molecular weight of 464.67 g/mol. Its IUPAC name is 1-O-[3-(2,3-dihydroxypropylsulfanyl)-2-hydroxypropyl] 5-O-(2-ethylhexyl) 4-ethyl-2,2-dimethylpentanedioate.
Molecular Properties
| Compound Name | 1-O-[3-(2,3-dihydroxypropylsulfanyl)-2-hydroxypropyl] 5-O-(2-ethylhexyl) 4-ethyl-2,2-dimethylpentanedioate |
| PubChem CID | 122691337 |
| Molecular Formula | C23H44O7S |
| Molecular Weight | 464.67 g/mol |
| Exact Mass | 464.28 |
| IUPAC Name | 1-O-[3-(2,3-dihydroxypropylsulfanyl)-2-hydroxypropyl] 5-O-(2-ethylhexyl) 4-ethyl-2,2-dimethylpentanedioate |
| SMILES | CCCCC(CC)COC(=O)C(CC)CC(C)(C)C(=O)OCC(O)CSCC(O)CO |
| InChI | InChI=1S/C23H44O7S/c1-6-9-10-17(7-2)13-29-21(27)18(8-3)11-23(4,5)22(28)30-14-20(26)16-31-15-19(25)12-24/h17-20,24-26H,6-16H2,1-5H3 |
| InChIKey | HMJUMOCTNOAGOV-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 464.67 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 1-O-[3-(2,3-dihydroxypropylsulfanyl)-2-hydroxypropyl] 5-O-(2-ethylhexyl) 4-ethyl-2,2-dimethylpentanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-[3-(2,3-dihydroxypropylsulfanyl)-2-hydroxypropyl] 5-O-(2-ethylhexyl) 4-ethyl-2,2-dimethylpentanedioate?
The IUPAC name of 1-O-[3-(2,3-dihydroxypropylsulfanyl)-2-hydroxypropyl] 5-O-(2-ethylhexyl) 4-ethyl-2,2-dimethylpentanedioate (CID 122691337) is 1-O-[3-(2,3-dihydroxypropylsulfanyl)-2-hydroxypropyl] 5-O-(2-ethylhexyl) 4-ethyl-2,2-dimethylpentanedioate.
What is the SMILES notation for 1-O-[3-(2,3-dihydroxypropylsulfanyl)-2-hydroxypropyl] 5-O-(2-ethylhexyl) 4-ethyl-2,2-dimethylpentanedioate?
The canonical SMILES for 1-O-[3-(2,3-dihydroxypropylsulfanyl)-2-hydroxypropyl] 5-O-(2-ethylhexyl) 4-ethyl-2,2-dimethylpentanedioate is CCCCC(CC)COC(=O)C(CC)CC(C)(C)C(=O)OCC(O)CSCC(O)CO.
What is the InChIKey of 1-O-[3-(2,3-dihydroxypropylsulfanyl)-2-hydroxypropyl] 5-O-(2-ethylhexyl) 4-ethyl-2,2-dimethylpentanedioate?
The InChIKey is HMJUMOCTNOAGOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H44O7S/c1-6-9-10-17(7-2)13-29-21(27)18(8-3)11-23(4,5)22(28)30-14-20(26)16-31-15-19(25)12-24/h17-20,24-26H,6-16H2,1-5H3.
What are the key properties of 1-O-[3-(2,3-dihydroxypropylsulfanyl)-2-hydroxypropyl] 5-O-(2-ethylhexyl) 4-ethyl-2,2-dimethylpentanedioate?
1-O-[3-(2,3-dihydroxypropylsulfanyl)-2-hydroxypropyl] 5-O-(2-ethylhexyl) 4-ethyl-2,2-dimethylpentanedioate has a molecular weight of 464.67 g/mol, XLogP of 3.18, 18 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-[3-(2,3-dihydroxypropylsulfanyl)-2-hydroxypropyl] 5-O-(2-ethylhexyl) 4-ethyl-2,2-dimethylpentanedioate is sourced from PubChem (CID 122691337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).