About 1-O-[3-(2,3-dihydroxypropylsulfanyl)-2-hydroxypropyl] 5-O-(2-methoxyethyl) 4-ethyl-2,2-dimethylpentanedioate
1-O-[3-(2,3-dihydroxypropylsulfanyl)-2-hydroxypropyl] 5-O-(2-methoxyethyl) 4-ethyl-2,2-dimethylpentanedioate (PubChem CID 122691354) has the molecular formula C18H34O8S
and a molecular weight of 410.53 g/mol. Its IUPAC name is 1-O-[3-(2,3-dihydroxypropylsulfanyl)-2-hydroxypropyl] 5-O-(2-methoxyethyl) 4-ethyl-2,2-dimethylpentanedioate.
Molecular Properties
| Compound Name | 1-O-[3-(2,3-dihydroxypropylsulfanyl)-2-hydroxypropyl] 5-O-(2-methoxyethyl) 4-ethyl-2,2-dimethylpentanedioate |
| PubChem CID | 122691354 |
| Molecular Formula | C18H34O8S |
| Molecular Weight | 410.53 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | 1-O-[3-(2,3-dihydroxypropylsulfanyl)-2-hydroxypropyl] 5-O-(2-methoxyethyl) 4-ethyl-2,2-dimethylpentanedioate |
| SMILES | CCC(CC(C)(C)C(=O)OCC(O)CSCC(O)CO)C(=O)OCCOC |
| InChI | InChI=1S/C18H34O8S/c1-5-13(16(22)25-7-6-24-4)8-18(2,3)17(23)26-10-15(21)12-27-11-14(20)9-19/h13-15,19-21H,5-12H2,1-4H3 |
| InChIKey | RLRDGMNERSDNFE-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 410.53 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-O-[3-(2,3-dihydroxypropylsulfanyl)-2-hydroxypropyl] 5-O-(2-methoxyethyl) 4-ethyl-2,2-dimethylpentanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-[3-(2,3-dihydroxypropylsulfanyl)-2-hydroxypropyl] 5-O-(2-methoxyethyl) 4-ethyl-2,2-dimethylpentanedioate?
The IUPAC name of 1-O-[3-(2,3-dihydroxypropylsulfanyl)-2-hydroxypropyl] 5-O-(2-methoxyethyl) 4-ethyl-2,2-dimethylpentanedioate (CID 122691354) is 1-O-[3-(2,3-dihydroxypropylsulfanyl)-2-hydroxypropyl] 5-O-(2-methoxyethyl) 4-ethyl-2,2-dimethylpentanedioate.
What is the SMILES notation for 1-O-[3-(2,3-dihydroxypropylsulfanyl)-2-hydroxypropyl] 5-O-(2-methoxyethyl) 4-ethyl-2,2-dimethylpentanedioate?
The canonical SMILES for 1-O-[3-(2,3-dihydroxypropylsulfanyl)-2-hydroxypropyl] 5-O-(2-methoxyethyl) 4-ethyl-2,2-dimethylpentanedioate is CCC(CC(C)(C)C(=O)OCC(O)CSCC(O)CO)C(=O)OCCOC.
What is the InChIKey of 1-O-[3-(2,3-dihydroxypropylsulfanyl)-2-hydroxypropyl] 5-O-(2-methoxyethyl) 4-ethyl-2,2-dimethylpentanedioate?
The InChIKey is RLRDGMNERSDNFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H34O8S/c1-5-13(16(22)25-7-6-24-4)8-18(2,3)17(23)26-10-15(21)12-27-11-14(20)9-19/h13-15,19-21H,5-12H2,1-4H3.
What are the key properties of 1-O-[3-(2,3-dihydroxypropylsulfanyl)-2-hydroxypropyl] 5-O-(2-methoxyethyl) 4-ethyl-2,2-dimethylpentanedioate?
1-O-[3-(2,3-dihydroxypropylsulfanyl)-2-hydroxypropyl] 5-O-(2-methoxyethyl) 4-ethyl-2,2-dimethylpentanedioate has a molecular weight of 410.53 g/mol, XLogP of 0.61, 15 rotatable bonds, 3 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-[3-(2,3-dihydroxypropylsulfanyl)-2-hydroxypropyl] 5-O-(2-methoxyethyl) 4-ethyl-2,2-dimethylpentanedioate is sourced from PubChem (CID 122691354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).