About 4-amino-2-hydroxy-2,5-dihydro-1H-1,3,5-triazin-6-one
4-amino-2-hydroxy-2,5-dihydro-1H-1,3,5-triazin-6-one (PubChem CID 122691685) has the molecular formula C3H6N4O2
and a molecular weight of 130.11 g/mol. Its IUPAC name is 4-amino-2-hydroxy-2,5-dihydro-1H-1,3,5-triazin-6-one.
Analyze 4-amino-2-hydroxy-2,5-dihydro-1H-1,3,5-triazin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-2-hydroxy-2,5-dihydro-1H-1,3,5-triazin-6-one?
The IUPAC name of 4-amino-2-hydroxy-2,5-dihydro-1H-1,3,5-triazin-6-one (CID 122691685) is 4-amino-2-hydroxy-2,5-dihydro-1H-1,3,5-triazin-6-one.
What is the SMILES notation for 4-amino-2-hydroxy-2,5-dihydro-1H-1,3,5-triazin-6-one?
The canonical SMILES for 4-amino-2-hydroxy-2,5-dihydro-1H-1,3,5-triazin-6-one is NC1=NC(O)NC(=O)N1.
What is the InChIKey of 4-amino-2-hydroxy-2,5-dihydro-1H-1,3,5-triazin-6-one?
The InChIKey is MTVGISLWTIDTOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6N4O2/c4-1-5-2(8)7-3(9)6-1/h2,8H,(H4,4,5,6,7,9).
What are the key properties of 4-amino-2-hydroxy-2,5-dihydro-1H-1,3,5-triazin-6-one?
4-amino-2-hydroxy-2,5-dihydro-1H-1,3,5-triazin-6-one has a molecular weight of 130.11 g/mol, XLogP of -2.11, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-2-hydroxy-2,5-dihydro-1H-1,3,5-triazin-6-one is sourced from PubChem (CID 122691685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).