C26H23N3OS — CID 122691768
[(3aS)-2-quinolin-2-yl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(2-thiophen-2-ylphenyl)methanone (PubChem CID 122691768) has the molecular formula C26H23N3OS and a molecular weight of 425.56 g/mol. Its IUPAC name is [(3aS)-2-quinolin-2-yl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(2-thiophen-2-ylphenyl)methanone.
| Compound Name | [(3aS)-2-quinolin-2-yl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(2-thiophen-2-ylphenyl)methanone |
|---|---|
| PubChem CID | 122691768 |
| Molecular Formula | C26H23N3OS |
| Molecular Weight | 425.56 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | [(3aS)-2-quinolin-2-yl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(2-thiophen-2-ylphenyl)methanone |
| SMILES | O=C(c1ccccc1-c1cccs1)N1CC2CN(c3ccc4ccccc4n3)C[C@H]2C1 |
| InChI | InChI=1S/C26H23N3OS/c30-26(22-8-3-2-7-21(22)24-10-5-13-31-24)29-16-19-14-28(15-20(19)17-29)25-12-11-18-6-1-4-9-23(18)27-25/h1-13,19-20H,14-17H2/t19-,20?/m0/s1 |
| InChIKey | BUGTXFLMSNXSIB-XJDOXCRVSA-N |
| XLogP | 5.17 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.56 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |