C23H25ClN2O — CID 122691825
(1R)-1-(6-chloro-8-methyl-4-phenyl-2-piperidin-1-ylquinolin-3-yl)ethanol (PubChem CID 122691825) has the molecular formula C23H25ClN2O and a molecular weight of 380.92 g/mol. Its IUPAC name is (1R)-1-(6-chloro-8-methyl-4-phenyl-2-piperidin-1-ylquinolin-3-yl)ethanol.
| Compound Name | (1R)-1-(6-chloro-8-methyl-4-phenyl-2-piperidin-1-ylquinolin-3-yl)ethanol |
|---|---|
| PubChem CID | 122691825 |
| Molecular Formula | C23H25ClN2O |
| Molecular Weight | 380.92 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | (1R)-1-(6-chloro-8-methyl-4-phenyl-2-piperidin-1-ylquinolin-3-yl)ethanol |
| SMILES | Cc1cc(Cl)cc2c(-c3ccccc3)c([C@@H](C)O)c(N3CCCCC3)nc12 |
| InChI | InChI=1S/C23H25ClN2O/c1-15-13-18(24)14-19-21(17-9-5-3-6-10-17)20(16(2)27)23(25-22(15)19)26-11-7-4-8-12-26/h3,5-6,9-10,13-14,16,27H,4,7-8,11-12H2,1-2H3/t16-/m1/s1 |
| InChIKey | YQCUMZCEHKDTLR-MRXNPFEDSA-N |
| XLogP | 5.91 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.92 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |