C23H20Cl2F2N2O2 — CID 122691890
N-[3-(3,4-dichlorophenyl)propyl]-6-(3,5-difluorophenyl)-3-hydroxy-1-methyl-2-methylidenepyridine-4-carboxamide (PubChem CID 122691890) has the molecular formula C23H20Cl2F2N2O2 and a molecular weight of 465.33 g/mol. Its IUPAC name is N-[3-(3,4-dichlorophenyl)propyl]-6-(3,5-difluorophenyl)-3-hydroxy-1-methyl-2-methylidenepyridine-4-carboxamide.
| Compound Name | N-[3-(3,4-dichlorophenyl)propyl]-6-(3,5-difluorophenyl)-3-hydroxy-1-methyl-2-methylidenepyridine-4-carboxamide |
|---|---|
| PubChem CID | 122691890 |
| Molecular Formula | C23H20Cl2F2N2O2 |
| Molecular Weight | 465.33 g/mol |
| Exact Mass | 464.09 |
| IUPAC Name | N-[3-(3,4-dichlorophenyl)propyl]-6-(3,5-difluorophenyl)-3-hydroxy-1-methyl-2-methylidenepyridine-4-carboxamide |
| SMILES | C=C1C(O)=C(C(=O)NCCCc2ccc(Cl)c(Cl)c2)C=C(c2cc(F)cc(F)c2)N1C |
| InChI | InChI=1S/C23H20Cl2F2N2O2/c1-13-22(30)18(12-21(29(13)2)15-9-16(26)11-17(27)10-15)23(31)28-7-3-4-14-5-6-19(24)20(25)8-14/h5-6,8-12,30H,1,3-4,7H2,2H3,(H,28,31) |
| InChIKey | QXQSUMOHSRSFNN-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.33 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|