About 5,8-dimethyl-8,8a-dihydrocinnoline
5,8-dimethyl-8,8a-dihydrocinnoline (PubChem CID 122691935) has the molecular formula C10H12N2
and a molecular weight of 160.22 g/mol. Its IUPAC name is 5,8-dimethyl-8,8a-dihydrocinnoline.
Molecular Properties
| Compound Name | 5,8-dimethyl-8,8a-dihydrocinnoline |
| PubChem CID | 122691935 |
| Molecular Formula | C10H12N2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | 5,8-dimethyl-8,8a-dihydrocinnoline |
| SMILES | CC1=C2C=CN=NC2C(C)C=C1 |
| InChI | InChI=1S/C10H12N2/c1-7-3-4-8(2)10-9(7)5-6-11-12-10/h3-6,8,10H,1-2H3 |
| InChIKey | LSJCHSTYQUDSRI-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5,8-dimethyl-8,8a-dihydrocinnoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,8-dimethyl-8,8a-dihydrocinnoline?
The IUPAC name of 5,8-dimethyl-8,8a-dihydrocinnoline (CID 122691935) is 5,8-dimethyl-8,8a-dihydrocinnoline.
What is the SMILES notation for 5,8-dimethyl-8,8a-dihydrocinnoline?
The canonical SMILES for 5,8-dimethyl-8,8a-dihydrocinnoline is CC1=C2C=CN=NC2C(C)C=C1.
What is the InChIKey of 5,8-dimethyl-8,8a-dihydrocinnoline?
The InChIKey is LSJCHSTYQUDSRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2/c1-7-3-4-8(2)10-9(7)5-6-11-12-10/h3-6,8,10H,1-2H3.
What are the key properties of 5,8-dimethyl-8,8a-dihydrocinnoline?
5,8-dimethyl-8,8a-dihydrocinnoline has a molecular weight of 160.22 g/mol, XLogP of 2.86, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,8-dimethyl-8,8a-dihydrocinnoline is sourced from PubChem (CID 122691935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).