About (2-oxopyrrolidin-3-yl) butanoate
(2-oxopyrrolidin-3-yl) butanoate (PubChem CID 122691995) has the molecular formula C8H13NO3
and a molecular weight of 171.20 g/mol. Its IUPAC name is (2-oxopyrrolidin-3-yl) butanoate.
Molecular Properties
| Compound Name | (2-oxopyrrolidin-3-yl) butanoate |
| PubChem CID | 122691995 |
| Molecular Formula | C8H13NO3 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.09 |
| IUPAC Name | (2-oxopyrrolidin-3-yl) butanoate |
| SMILES | CCCC(=O)OC1CCNC1=O |
| InChI | InChI=1S/C8H13NO3/c1-2-3-7(10)12-6-4-5-9-8(6)11/h6H,2-5H2,1H3,(H,9,11) |
| InChIKey | SKPZPAFCFVSWJE-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2-oxopyrrolidin-3-yl) butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-oxopyrrolidin-3-yl) butanoate?
The IUPAC name of (2-oxopyrrolidin-3-yl) butanoate (CID 122691995) is (2-oxopyrrolidin-3-yl) butanoate.
What is the SMILES notation for (2-oxopyrrolidin-3-yl) butanoate?
The canonical SMILES for (2-oxopyrrolidin-3-yl) butanoate is CCCC(=O)OC1CCNC1=O.
What is the InChIKey of (2-oxopyrrolidin-3-yl) butanoate?
The InChIKey is SKPZPAFCFVSWJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO3/c1-2-3-7(10)12-6-4-5-9-8(6)11/h6H,2-5H2,1H3,(H,9,11).
What are the key properties of (2-oxopyrrolidin-3-yl) butanoate?
(2-oxopyrrolidin-3-yl) butanoate has a molecular weight of 171.20 g/mol, XLogP of 0.22, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-oxopyrrolidin-3-yl) butanoate is sourced from PubChem (CID 122691995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).