About N,5-dimethyl-1,2-dihydropyridine-2-carboxamide
N,5-dimethyl-1,2-dihydropyridine-2-carboxamide (PubChem CID 122692046) has the molecular formula C8H12N2O
and a molecular weight of 152.20 g/mol. Its IUPAC name is N,5-dimethyl-1,2-dihydropyridine-2-carboxamide.
Molecular Properties
| Compound Name | N,5-dimethyl-1,2-dihydropyridine-2-carboxamide |
| PubChem CID | 122692046 |
| Molecular Formula | C8H12N2O |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.09 |
| IUPAC Name | N,5-dimethyl-1,2-dihydropyridine-2-carboxamide |
| SMILES | CNC(=O)C1C=CC(C)=CN1 |
| InChI | InChI=1S/C8H12N2O/c1-6-3-4-7(10-5-6)8(11)9-2/h3-5,7,10H,1-2H3,(H,9,11) |
| InChIKey | UTTKCIYCWHLHNY-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N,5-dimethyl-1,2-dihydropyridine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,5-dimethyl-1,2-dihydropyridine-2-carboxamide?
The IUPAC name of N,5-dimethyl-1,2-dihydropyridine-2-carboxamide (CID 122692046) is N,5-dimethyl-1,2-dihydropyridine-2-carboxamide.
What is the SMILES notation for N,5-dimethyl-1,2-dihydropyridine-2-carboxamide?
The canonical SMILES for N,5-dimethyl-1,2-dihydropyridine-2-carboxamide is CNC(=O)C1C=CC(C)=CN1.
What is the InChIKey of N,5-dimethyl-1,2-dihydropyridine-2-carboxamide?
The InChIKey is UTTKCIYCWHLHNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O/c1-6-3-4-7(10-5-6)8(11)9-2/h3-5,7,10H,1-2H3,(H,9,11).
What are the key properties of N,5-dimethyl-1,2-dihydropyridine-2-carboxamide?
N,5-dimethyl-1,2-dihydropyridine-2-carboxamide has a molecular weight of 152.20 g/mol, XLogP of 0.16, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,5-dimethyl-1,2-dihydropyridine-2-carboxamide is sourced from PubChem (CID 122692046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).