C21H43N3 — CID 122692131
(12Z)-7,8,13-triethylpentadeca-12,14-diene-4,6,11-triamine (PubChem CID 122692131) has the molecular formula C21H43N3 and a molecular weight of 337.60 g/mol. Its IUPAC name is (12Z)-7,8,13-triethylpentadeca-12,14-diene-4,6,11-triamine.
| Compound Name | (12Z)-7,8,13-triethylpentadeca-12,14-diene-4,6,11-triamine |
|---|---|
| PubChem CID | 122692131 |
| Molecular Formula | C21H43N3 |
| Molecular Weight | 337.60 g/mol |
| Exact Mass | 337.35 |
| IUPAC Name | (12Z)-7,8,13-triethylpentadeca-12,14-diene-4,6,11-triamine |
| SMILES | C=C/C(=C\C(N)CCC(CC)C(CC)C(N)CC(N)CCC)CC |
| InChI | InChI=1S/C21H43N3/c1-6-11-18(22)15-21(24)20(10-5)17(9-4)12-13-19(23)14-16(7-2)8-3/h7,14,17-21H,2,6,8-13,15,22-24H2,1,3-5H3/b16-14+ |
| InChIKey | IZHSTJQOSNCUNJ-JQIJEIRASA-N |
| XLogP | 4.51 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.60 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|