About (2,3-dimethylcyclohexa-1,3-dien-1-yl)methanol
(2,3-dimethylcyclohexa-1,3-dien-1-yl)methanol (PubChem CID 122692141) has the molecular formula C9H14O
and a molecular weight of 138.21 g/mol. Its IUPAC name is (2,3-dimethylcyclohexa-1,3-dien-1-yl)methanol.
Molecular Properties
| Compound Name | (2,3-dimethylcyclohexa-1,3-dien-1-yl)methanol |
| PubChem CID | 122692141 |
| Molecular Formula | C9H14O |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.10 |
| IUPAC Name | (2,3-dimethylcyclohexa-1,3-dien-1-yl)methanol |
| SMILES | CC1=CCCC(CO)=C1C |
| InChI | InChI=1S/C9H14O/c1-7-4-3-5-9(6-10)8(7)2/h4,10H,3,5-6H2,1-2H3 |
| InChIKey | OKEHJAFMUKWSRV-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2,3-dimethylcyclohexa-1,3-dien-1-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,3-dimethylcyclohexa-1,3-dien-1-yl)methanol?
The IUPAC name of (2,3-dimethylcyclohexa-1,3-dien-1-yl)methanol (CID 122692141) is (2,3-dimethylcyclohexa-1,3-dien-1-yl)methanol.
What is the SMILES notation for (2,3-dimethylcyclohexa-1,3-dien-1-yl)methanol?
The canonical SMILES for (2,3-dimethylcyclohexa-1,3-dien-1-yl)methanol is CC1=CCCC(CO)=C1C.
What is the InChIKey of (2,3-dimethylcyclohexa-1,3-dien-1-yl)methanol?
The InChIKey is OKEHJAFMUKWSRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O/c1-7-4-3-5-9(6-10)8(7)2/h4,10H,3,5-6H2,1-2H3.
What are the key properties of (2,3-dimethylcyclohexa-1,3-dien-1-yl)methanol?
(2,3-dimethylcyclohexa-1,3-dien-1-yl)methanol has a molecular weight of 138.21 g/mol, XLogP of 2.04, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2,3-dimethylcyclohexa-1,3-dien-1-yl)methanol is sourced from PubChem (CID 122692141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).