C26H34Cl2N4O2S2 — CID 122692249
5-[3-[bis(2-chloroethyl)amino]phenyl]-N-[5-[(5-tert-butyl-1,3-oxazol-2-yl)methylsulfanyl]-1,3-thiazol-2-yl]pentanamide (PubChem CID 122692249) has the molecular formula C26H34Cl2N4O2S2 and a molecular weight of 569.62 g/mol. Its IUPAC name is 5-[3-[bis(2-chloroethyl)amino]phenyl]-N-[5-[(5-tert-butyl-1,3-oxazol-2-yl)methylsulfanyl]-1,3-thiazol-2-yl]pentanamide.
| Compound Name | 5-[3-[bis(2-chloroethyl)amino]phenyl]-N-[5-[(5-tert-butyl-1,3-oxazol-2-yl)methylsulfanyl]-1,3-thiazol-2-yl]pentanamide |
|---|---|
| PubChem CID | 122692249 |
| Molecular Formula | C26H34Cl2N4O2S2 |
| Molecular Weight | 569.62 g/mol |
| Exact Mass | 568.15 |
| IUPAC Name | 5-[3-[bis(2-chloroethyl)amino]phenyl]-N-[5-[(5-tert-butyl-1,3-oxazol-2-yl)methylsulfanyl]-1,3-thiazol-2-yl]pentanamide |
| SMILES | CC(C)(C)c1cnc(CSc2cnc(NC(=O)CCCCc3cccc(N(CCCl)CCCl)c3)s2)o1 |
| InChI | InChI=1S/C26H34Cl2N4O2S2/c1-26(2,3)21-16-29-23(34-21)18-35-24-17-30-25(36-24)31-22(33)10-5-4-7-19-8-6-9-20(15-19)32(13-11-27)14-12-28/h6,8-9,15-17H,4-5,7,10-14,18H2,1-3H3,(H,30,31,33) |
| InChIKey | BBWHIUCIMSYADJ-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 71.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.62 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|