C9H17F — CID 122693333
cis-(4R,5S)-1-fluoro-2,4,5-trimethylcyclohexane (PubChem CID 122693333) has the molecular formula C9H17F and a molecular weight of 144.23 g/mol. Its IUPAC name is cis-(4R,5S)-1-fluoro-2,4,5-trimethylcyclohexane.
| Compound Name | cis-(4R,5S)-1-fluoro-2,4,5-trimethylcyclohexane |
|---|---|
| PubChem CID | 122693333 |
| Molecular Formula | C9H17F |
| Molecular Weight | 144.23 g/mol |
| Exact Mass | 144.13 |
| IUPAC Name | cis-(4R,5S)-1-fluoro-2,4,5-trimethylcyclohexane |
| SMILES | CC1C[C@@H](C)[C@@H](C)CC1F |
| InChI | InChI=1S/C9H17F/c1-6-4-8(3)9(10)5-7(6)2/h6-9H,4-5H2,1-3H3/t6-,7+,8?,9?/m1/s1 |
| InChIKey | HZGAVCLWIVQALC-DKATWDMPSA-N |
| XLogP | 3.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.23 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |