About (2S)-N,4-dimethyl-1-propan-2-yloxypentan-2-amine
(2S)-N,4-dimethyl-1-propan-2-yloxypentan-2-amine (PubChem CID 122693959) has the molecular formula C10H23NO
and a molecular weight of 173.30 g/mol. Its IUPAC name is (2S)-N,4-dimethyl-1-propan-2-yloxypentan-2-amine.
Molecular Properties
| Compound Name | (2S)-N,4-dimethyl-1-propan-2-yloxypentan-2-amine |
| PubChem CID | 122693959 |
| Molecular Formula | C10H23NO |
| Molecular Weight | 173.30 g/mol |
| Exact Mass | 173.18 |
| IUPAC Name | (2S)-N,4-dimethyl-1-propan-2-yloxypentan-2-amine |
| SMILES | CN[C@H](COC(C)C)CC(C)C |
| InChI | InChI=1S/C10H23NO/c1-8(2)6-10(11-5)7-12-9(3)4/h8-11H,6-7H2,1-5H3/t10-/m0/s1 |
| InChIKey | CJEIGUIPKCYIEV-JTQLQIEISA-N |
| XLogP | 2.05 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.30 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S)-N,4-dimethyl-1-propan-2-yloxypentan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-N,4-dimethyl-1-propan-2-yloxypentan-2-amine?
The IUPAC name of (2S)-N,4-dimethyl-1-propan-2-yloxypentan-2-amine (CID 122693959) is (2S)-N,4-dimethyl-1-propan-2-yloxypentan-2-amine.
What is the SMILES notation for (2S)-N,4-dimethyl-1-propan-2-yloxypentan-2-amine?
The canonical SMILES for (2S)-N,4-dimethyl-1-propan-2-yloxypentan-2-amine is CN[C@H](COC(C)C)CC(C)C.
What is the InChIKey of (2S)-N,4-dimethyl-1-propan-2-yloxypentan-2-amine?
The InChIKey is CJEIGUIPKCYIEV-JTQLQIEISA-N. The full InChI is InChI=1S/C10H23NO/c1-8(2)6-10(11-5)7-12-9(3)4/h8-11H,6-7H2,1-5H3/t10-/m0/s1.
What are the key properties of (2S)-N,4-dimethyl-1-propan-2-yloxypentan-2-amine?
(2S)-N,4-dimethyl-1-propan-2-yloxypentan-2-amine has a molecular weight of 173.30 g/mol, XLogP of 2.05, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-N,4-dimethyl-1-propan-2-yloxypentan-2-amine is sourced from PubChem (CID 122693959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).