About (4S)-1,1-difluoro-6,6-dimethylhept-1-en-4-amine
(4S)-1,1-difluoro-6,6-dimethylhept-1-en-4-amine (PubChem CID 122693960) has the molecular formula C9H17F2N
and a molecular weight of 177.24 g/mol. Its IUPAC name is (4S)-1,1-difluoro-6,6-dimethylhept-1-en-4-amine.
Molecular Properties
| Compound Name | (4S)-1,1-difluoro-6,6-dimethylhept-1-en-4-amine |
| PubChem CID | 122693960 |
| Molecular Formula | C9H17F2N |
| Molecular Weight | 177.24 g/mol |
| Exact Mass | 177.13 |
| IUPAC Name | (4S)-1,1-difluoro-6,6-dimethylhept-1-en-4-amine |
| SMILES | CC(C)(C)C[C@@H](N)CC=C(F)F |
| InChI | InChI=1S/C9H17F2N/c1-9(2,3)6-7(12)4-5-8(10)11/h5,7H,4,6,12H2,1-3H3/t7-/m0/s1 |
| InChIKey | RZSAPYYIKQJPGL-ZETCQYMHSA-N |
| XLogP | 2.92 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.24 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (4S)-1,1-difluoro-6,6-dimethylhept-1-en-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-1,1-difluoro-6,6-dimethylhept-1-en-4-amine?
The IUPAC name of (4S)-1,1-difluoro-6,6-dimethylhept-1-en-4-amine (CID 122693960) is (4S)-1,1-difluoro-6,6-dimethylhept-1-en-4-amine.
What is the SMILES notation for (4S)-1,1-difluoro-6,6-dimethylhept-1-en-4-amine?
The canonical SMILES for (4S)-1,1-difluoro-6,6-dimethylhept-1-en-4-amine is CC(C)(C)C[C@@H](N)CC=C(F)F.
What is the InChIKey of (4S)-1,1-difluoro-6,6-dimethylhept-1-en-4-amine?
The InChIKey is RZSAPYYIKQJPGL-ZETCQYMHSA-N. The full InChI is InChI=1S/C9H17F2N/c1-9(2,3)6-7(12)4-5-8(10)11/h5,7H,4,6,12H2,1-3H3/t7-/m0/s1.
What are the key properties of (4S)-1,1-difluoro-6,6-dimethylhept-1-en-4-amine?
(4S)-1,1-difluoro-6,6-dimethylhept-1-en-4-amine has a molecular weight of 177.24 g/mol, XLogP of 2.92, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-1,1-difluoro-6,6-dimethylhept-1-en-4-amine is sourced from PubChem (CID 122693960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).