C28H30N6O2 — CID 122694847
5-(3,5-dimethyltriazol-4-yl)-13-ethoxy-8-[(S)-oxan-4-yl(phenyl)methyl]-3,8,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene (PubChem CID 122694847) has the molecular formula C28H30N6O2 and a molecular weight of 482.59 g/mol. Its IUPAC name is 5-(3,5-dimethyltriazol-4-yl)-13-ethoxy-8-[(S)-oxan-4-yl(phenyl)methyl]-3,8,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene.
| Compound Name | 5-(3,5-dimethyltriazol-4-yl)-13-ethoxy-8-[(S)-oxan-4-yl(phenyl)methyl]-3,8,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
|---|---|
| PubChem CID | 122694847 |
| Molecular Formula | C28H30N6O2 |
| Molecular Weight | 482.59 g/mol |
| Exact Mass | 482.24 |
| IUPAC Name | 5-(3,5-dimethyltriazol-4-yl)-13-ethoxy-8-[(S)-oxan-4-yl(phenyl)methyl]-3,8,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
| SMILES | CCOc1nccc2c1c1ncc(-c3c(C)nnn3C)cc1n2C(c1ccccc1)C1CCOCC1 |
| InChI | InChI=1S/C28H30N6O2/c1-4-36-28-24-22(10-13-29-28)34(27(19-8-6-5-7-9-19)20-11-14-35-15-12-20)23-16-21(17-30-25(23)24)26-18(2)31-32-33(26)3/h5-10,13,16-17,20,27H,4,11-12,14-15H2,1-3H3 |
| InChIKey | KXARWDBESSTWMC-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 79.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.59 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |