C30H34N8O — CID 122694896
5-(3,5-dimethyltriazol-4-yl)-8-[(S)-oxan-4-yl(phenyl)methyl]-11-piperazin-1-yl-3,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene (PubChem CID 122694896) has the molecular formula C30H34N8O and a molecular weight of 522.66 g/mol. Its IUPAC name is 5-(3,5-dimethyltriazol-4-yl)-8-[(S)-oxan-4-yl(phenyl)methyl]-11-piperazin-1-yl-3,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene.
| Compound Name | 5-(3,5-dimethyltriazol-4-yl)-8-[(S)-oxan-4-yl(phenyl)methyl]-11-piperazin-1-yl-3,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
|---|---|
| PubChem CID | 122694896 |
| Molecular Formula | C30H34N8O |
| Molecular Weight | 522.66 g/mol |
| Exact Mass | 522.29 |
| IUPAC Name | 5-(3,5-dimethyltriazol-4-yl)-8-[(S)-oxan-4-yl(phenyl)methyl]-11-piperazin-1-yl-3,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
| SMILES | Cc1nnn(C)c1-c1cnc2c3ccc(N4CCNCC4)nc3n([C@H](c3ccccc3)C3CCOCC3)c2c1 |
| InChI | InChI=1S/C30H34N8O/c1-20-28(36(2)35-34-20)23-18-25-27(32-19-23)24-8-9-26(37-14-12-31-13-15-37)33-30(24)38(25)29(21-6-4-3-5-7-21)22-10-16-39-17-11-22/h3-9,18-19,22,29,31H,10-17H2,1-2H3/t29-/m1/s1 |
| InChIKey | UZHYZRFHOQRRAN-GDLZYMKVSA-N |
| XLogP | 4.11 |
| TPSA | 85.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.66 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |