C25H23ClFN7O — CID 122694897
11-chloro-5-(3,5-dimethyltriazol-4-yl)-8-[(3-fluoro-2-pyridinyl)-(oxan-4-yl)methyl]-3,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene (PubChem CID 122694897) has the molecular formula C25H23ClFN7O and a molecular weight of 491.96 g/mol. Its IUPAC name is 11-chloro-5-(3,5-dimethyltriazol-4-yl)-8-[(3-fluoro-2-pyridinyl)-(oxan-4-yl)methyl]-3,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene.
| Compound Name | 11-chloro-5-(3,5-dimethyltriazol-4-yl)-8-[(3-fluoro-2-pyridinyl)-(oxan-4-yl)methyl]-3,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
|---|---|
| PubChem CID | 122694897 |
| Molecular Formula | C25H23ClFN7O |
| Molecular Weight | 491.96 g/mol |
| Exact Mass | 491.16 |
| IUPAC Name | 11-chloro-5-(3,5-dimethyltriazol-4-yl)-8-[(3-fluoro-2-pyridinyl)-(oxan-4-yl)methyl]-3,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
| SMILES | Cc1nnn(C)c1-c1cnc2c3ccc(Cl)nc3n(C(c3ncccc3F)C3CCOCC3)c2c1 |
| InChI | InChI=1S/C25H23ClFN7O/c1-14-23(33(2)32-31-14)16-12-19-21(29-13-16)17-5-6-20(26)30-25(17)34(19)24(15-7-10-35-11-8-15)22-18(27)4-3-9-28-22/h3-6,9,12-13,15,24H,7-8,10-11H2,1-2H3 |
| InChIKey | WOWWQPJEIZZPOO-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 83.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.96 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|