C26H25ClFN7O2 — CID 122694927
11-chloro-5-(3,5-dimethyltriazol-4-yl)-8-[(S)-(3-fluoro-2-pyridinyl)-(oxan-4-yl)methyl]-13-methoxy-3,8,12-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene (PubChem CID 122694927) has the molecular formula C26H25ClFN7O2 and a molecular weight of 521.98 g/mol. Its IUPAC name is 11-chloro-5-(3,5-dimethyltriazol-4-yl)-8-[(S)-(3-fluoro-2-pyridinyl)-(oxan-4-yl)methyl]-13-methoxy-3,8,12-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene.
| Compound Name | 11-chloro-5-(3,5-dimethyltriazol-4-yl)-8-[(S)-(3-fluoro-2-pyridinyl)-(oxan-4-yl)methyl]-13-methoxy-3,8,12-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene |
|---|---|
| PubChem CID | 122694927 |
| Molecular Formula | C26H25ClFN7O2 |
| Molecular Weight | 521.98 g/mol |
| Exact Mass | 521.17 |
| IUPAC Name | 11-chloro-5-(3,5-dimethyltriazol-4-yl)-8-[(S)-(3-fluoro-2-pyridinyl)-(oxan-4-yl)methyl]-13-methoxy-3,8,12-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene |
| SMILES | COc1nc(Cl)cc2c1c1ncc(-c3c(C)nnn3C)cc1n2[C@H](c1ncccc1F)C1CCOCC1 |
| InChI | InChI=1S/C26H25ClFN7O2/c1-14-24(34(2)33-32-14)16-11-19-23(30-13-16)21-18(12-20(27)31-26(21)36-3)35(19)25(15-6-9-37-10-7-15)22-17(28)5-4-8-29-22/h4-5,8,11-13,15,25H,6-7,9-10H2,1-3H3/t25-/m0/s1 |
| InChIKey | PUWJKFWGJVINBS-VWLOTQADSA-N |
| XLogP | 4.90 |
| TPSA | 92.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.98 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|