C27H30N6O — CID 122694962
2-[11-(3,5-dimethyltriazol-4-yl)-8-(1-phenylbutyl)-3,8,12-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaen-5-yl]propan-2-ol (PubChem CID 122694962) has the molecular formula C27H30N6O and a molecular weight of 454.58 g/mol. Its IUPAC name is 2-[11-(3,5-dimethyltriazol-4-yl)-8-(1-phenylbutyl)-3,8,12-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaen-5-yl]propan-2-ol.
| Compound Name | 2-[11-(3,5-dimethyltriazol-4-yl)-8-(1-phenylbutyl)-3,8,12-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaen-5-yl]propan-2-ol |
|---|---|
| PubChem CID | 122694962 |
| Molecular Formula | C27H30N6O |
| Molecular Weight | 454.58 g/mol |
| Exact Mass | 454.25 |
| IUPAC Name | 2-[11-(3,5-dimethyltriazol-4-yl)-8-(1-phenylbutyl)-3,8,12-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaen-5-yl]propan-2-ol |
| SMILES | CCCC(c1ccccc1)n1c2cc(-c3c(C)nnn3C)ncc2c2ncc(C(C)(C)O)cc21 |
| InChI | InChI=1S/C27H30N6O/c1-6-10-22(18-11-8-7-9-12-18)33-23-14-21(26-17(2)30-31-32(26)5)28-16-20(23)25-24(33)13-19(15-29-25)27(3,4)34/h7-9,11-16,22,34H,6,10H2,1-5H3 |
| InChIKey | WCAGWDZHTLUHHZ-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.58 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |