C20H23ClN4O3 — CID 122694974
benzyl (4aS,8aS)-6-[(2-chloropyrimidin-5-yl)methyl]-3,4a,5,7,8,8a-hexahydro-2H-pyrido[3,4-b][1,4]oxazine-1-carboxylate (PubChem CID 122694974) has the molecular formula C20H23ClN4O3 and a molecular weight of 402.88 g/mol. Its IUPAC name is benzyl (4aS,8aS)-6-[(2-chloropyrimidin-5-yl)methyl]-3,4a,5,7,8,8a-hexahydro-2H-pyrido[3,4-b][1,4]oxazine-1-carboxylate.
| Compound Name | benzyl (4aS,8aS)-6-[(2-chloropyrimidin-5-yl)methyl]-3,4a,5,7,8,8a-hexahydro-2H-pyrido[3,4-b][1,4]oxazine-1-carboxylate |
|---|---|
| PubChem CID | 122694974 |
| Molecular Formula | C20H23ClN4O3 |
| Molecular Weight | 402.88 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | benzyl (4aS,8aS)-6-[(2-chloropyrimidin-5-yl)methyl]-3,4a,5,7,8,8a-hexahydro-2H-pyrido[3,4-b][1,4]oxazine-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CCO[C@H]2CN(Cc3cnc(Cl)nc3)CC[C@@H]21 |
| InChI | InChI=1S/C20H23ClN4O3/c21-19-22-10-16(11-23-19)12-24-7-6-17-18(13-24)27-9-8-25(17)20(26)28-14-15-4-2-1-3-5-15/h1-5,10-11,17-18H,6-9,12-14H2/t17-,18-/m0/s1 |
| InChIKey | JMCDGOFQTCKNHE-ROUUACIJSA-N |
| XLogP | 2.74 |
| TPSA | 67.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.88 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |