About 5-tert-butyl-4-(2,3,3-trimethylbutan-2-yl)-2H-pyrrole
5-tert-butyl-4-(2,3,3-trimethylbutan-2-yl)-2H-pyrrole (PubChem CID 122694994) has the molecular formula C15H27N
and a molecular weight of 221.39 g/mol. Its IUPAC name is 5-tert-butyl-4-(2,3,3-trimethylbutan-2-yl)-2H-pyrrole.
Molecular Properties
| Compound Name | 5-tert-butyl-4-(2,3,3-trimethylbutan-2-yl)-2H-pyrrole |
| PubChem CID | 122694994 |
| Molecular Formula | C15H27N |
| Molecular Weight | 221.39 g/mol |
| Exact Mass | 221.21 |
| IUPAC Name | 5-tert-butyl-4-(2,3,3-trimethylbutan-2-yl)-2H-pyrrole |
| SMILES | CC(C)(C)C1=NCC=C1C(C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H27N/c1-13(2,3)12-11(9-10-16-12)15(7,8)14(4,5)6/h9H,10H2,1-8H3 |
| InChIKey | HGYXHNOCVPWRDS-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.39 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-tert-butyl-4-(2,3,3-trimethylbutan-2-yl)-2H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-tert-butyl-4-(2,3,3-trimethylbutan-2-yl)-2H-pyrrole?
The IUPAC name of 5-tert-butyl-4-(2,3,3-trimethylbutan-2-yl)-2H-pyrrole (CID 122694994) is 5-tert-butyl-4-(2,3,3-trimethylbutan-2-yl)-2H-pyrrole.
What is the SMILES notation for 5-tert-butyl-4-(2,3,3-trimethylbutan-2-yl)-2H-pyrrole?
The canonical SMILES for 5-tert-butyl-4-(2,3,3-trimethylbutan-2-yl)-2H-pyrrole is CC(C)(C)C1=NCC=C1C(C)(C)C(C)(C)C.
What is the InChIKey of 5-tert-butyl-4-(2,3,3-trimethylbutan-2-yl)-2H-pyrrole?
The InChIKey is HGYXHNOCVPWRDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H27N/c1-13(2,3)12-11(9-10-16-12)15(7,8)14(4,5)6/h9H,10H2,1-8H3.
What are the key properties of 5-tert-butyl-4-(2,3,3-trimethylbutan-2-yl)-2H-pyrrole?
5-tert-butyl-4-(2,3,3-trimethylbutan-2-yl)-2H-pyrrole has a molecular weight of 221.39 g/mol, XLogP of 4.49, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-tert-butyl-4-(2,3,3-trimethylbutan-2-yl)-2H-pyrrole is sourced from PubChem (CID 122694994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).