C14H26N2 — CID 122695042
5-tert-butyl-4-(2,3,3-trimethylbutan-2-yl)-1H-pyrazole (PubChem CID 122695042) has the molecular formula C14H26N2 and a molecular weight of 222.38 g/mol. Its IUPAC name is 5-tert-butyl-4-(2,3,3-trimethylbutan-2-yl)-1H-pyrazole.
| Compound Name | 5-tert-butyl-4-(2,3,3-trimethylbutan-2-yl)-1H-pyrazole |
|---|---|
| PubChem CID | 122695042 |
| Molecular Formula | C14H26N2 |
| Molecular Weight | 222.38 g/mol |
| Exact Mass | 222.21 |
| IUPAC Name | 5-tert-butyl-4-(2,3,3-trimethylbutan-2-yl)-1H-pyrazole |
| SMILES | CC(C)(C)c1[nH]ncc1C(C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H26N2/c1-12(2,3)11-10(9-15-16-11)14(7,8)13(4,5)6/h9H,1-8H3,(H,15,16) |
| InChIKey | VABHIOFWZJRYNY-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.38 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |