C17H26O7 — CID 122695058
[(2S,3R,4S,5S,6S)-4,5-diacetyloxy-6-but-3-enyl-3-methyloxan-2-yl]methyl acetate (PubChem CID 122695058) has the molecular formula C17H26O7 and a molecular weight of 342.39 g/mol. Its IUPAC name is [(2S,3R,4S,5S,6S)-4,5-diacetyloxy-6-but-3-enyl-3-methyloxan-2-yl]methyl acetate.
| Compound Name | [(2S,3R,4S,5S,6S)-4,5-diacetyloxy-6-but-3-enyl-3-methyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 122695058 |
| Molecular Formula | C17H26O7 |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | [(2S,3R,4S,5S,6S)-4,5-diacetyloxy-6-but-3-enyl-3-methyloxan-2-yl]methyl acetate |
| SMILES | C=CCC[C@@H]1O[C@H](COC(C)=O)[C@@H](C)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C17H26O7/c1-6-7-8-14-17(23-13(5)20)16(22-12(4)19)10(2)15(24-14)9-21-11(3)18/h6,10,14-17H,1,7-9H2,2-5H3/t10-,14+,15-,16+,17+/m1/s1 |
| InChIKey | GZXYGHDMXSDJMX-LTDQNJCQSA-N |
| XLogP | 1.78 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|