C20H26F12O — CID 122695112
1-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)-4-[4-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)cyclohexyl]oxycyclohexane (PubChem CID 122695112) has the molecular formula C20H26F12O and a molecular weight of 510.40 g/mol. Its IUPAC name is 1-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)-4-[4-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)cyclohexyl]oxycyclohexane.
| Compound Name | 1-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)-4-[4-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)cyclohexyl]oxycyclohexane |
|---|---|
| PubChem CID | 122695112 |
| Molecular Formula | C20H26F12O |
| Molecular Weight | 510.40 g/mol |
| Exact Mass | 510.18 |
| IUPAC Name | 1-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)-4-[4-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)cyclohexyl]oxycyclohexane |
| SMILES | CC(C1CCC(OC2CCC(C(C)(C(F)(F)F)C(F)(F)F)CC2)CC1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C20H26F12O/c1-15(17(21,22)23,18(24,25)26)11-3-7-13(8-4-11)33-14-9-5-12(6-10-14)16(2,19(27,28)29)20(30,31)32/h11-14H,3-10H2,1-2H3 |
| InChIKey | HFBBRXVKPSTECY-UHFFFAOYSA-N |
| XLogP | 8.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.40 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |