C26H25FN6O3 — CID 122695189
1-[3-[4-amino-3-[4-(3-methoxyphenoxy)phenyl]pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]-2-fluoroprop-2-en-1-one (PubChem CID 122695189) has the molecular formula C26H25FN6O3 and a molecular weight of 488.52 g/mol. Its IUPAC name is 1-[3-[4-amino-3-[4-(3-methoxyphenoxy)phenyl]pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]-2-fluoroprop-2-en-1-one.
| Compound Name | 1-[3-[4-amino-3-[4-(3-methoxyphenoxy)phenyl]pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]-2-fluoroprop-2-en-1-one |
|---|---|
| PubChem CID | 122695189 |
| Molecular Formula | C26H25FN6O3 |
| Molecular Weight | 488.52 g/mol |
| Exact Mass | 488.20 |
| IUPAC Name | 1-[3-[4-amino-3-[4-(3-methoxyphenoxy)phenyl]pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]-2-fluoroprop-2-en-1-one |
| SMILES | C=C(F)C(=O)N1CCCC(n2nc(-c3ccc(Oc4cccc(OC)c4)cc3)c3c(N)ncnc32)C1 |
| InChI | InChI=1S/C26H25FN6O3/c1-16(27)26(34)32-12-4-5-18(14-32)33-25-22(24(28)29-15-30-25)23(31-33)17-8-10-19(11-9-17)36-21-7-3-6-20(13-21)35-2/h3,6-11,13,15,18H,1,4-5,12,14H2,2H3,(H2,28,29,30) |
| InChIKey | TYOSCJZYINEGIK-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 108.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.52 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|