C19H30O6 — CID 122695387
2-[(2R,4R)-4-(4-butoxy-4-methylpent-2-ynyl)-2-tert-butyl-5-oxo-1,3-dioxolan-4-yl]acetic acid (PubChem CID 122695387) has the molecular formula C19H30O6 and a molecular weight of 354.44 g/mol. Its IUPAC name is 2-[(2R,4R)-4-(4-butoxy-4-methylpent-2-ynyl)-2-tert-butyl-5-oxo-1,3-dioxolan-4-yl]acetic acid.
| Compound Name | 2-[(2R,4R)-4-(4-butoxy-4-methylpent-2-ynyl)-2-tert-butyl-5-oxo-1,3-dioxolan-4-yl]acetic acid |
|---|---|
| PubChem CID | 122695387 |
| Molecular Formula | C19H30O6 |
| Molecular Weight | 354.44 g/mol |
| Exact Mass | 354.20 |
| IUPAC Name | 2-[(2R,4R)-4-(4-butoxy-4-methylpent-2-ynyl)-2-tert-butyl-5-oxo-1,3-dioxolan-4-yl]acetic acid |
| SMILES | CCCCOC(C)(C)C#CC[C@]1(CC(=O)O)O[C@@H](C(C)(C)C)OC1=O |
| InChI | InChI=1S/C19H30O6/c1-7-8-12-23-18(5,6)10-9-11-19(13-14(20)21)15(22)24-16(25-19)17(2,3)4/h16H,7-8,11-13H2,1-6H3,(H,20,21)/t16-,19+/m0/s1 |
| InChIKey | CSZFPGZPZXAQJU-QFBILLFUSA-N |
| XLogP | 3.13 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.44 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|