C19H22O7 — CID 122695870
(1S,2S,4S,5S,7R,8R,9S,11S,13S)-8-hydroxy-7-(2-hydroxyethyl)-1-methyl-3,6,10,16-tetraoxaheptacyclo[11.7.0.02,4.02,9.05,7.09,11.014,18]icos-14(18)-en-17-one (PubChem CID 122695870) has the molecular formula C19H22O7 and a molecular weight of 362.38 g/mol. Its IUPAC name is (1S,2S,4S,5S,7R,8R,9S,11S,13S)-8-hydroxy-7-(2-hydroxyethyl)-1-methyl-3,6,10,16-tetraoxaheptacyclo[11.7.0.02,4.02,9.05,7.09,11.014,18]icos-14(18)-en-17-one.
| Compound Name | (1S,2S,4S,5S,7R,8R,9S,11S,13S)-8-hydroxy-7-(2-hydroxyethyl)-1-methyl-3,6,10,16-tetraoxaheptacyclo[11.7.0.02,4.02,9.05,7.09,11.014,18]icos-14(18)-en-17-one |
|---|---|
| PubChem CID | 122695870 |
| Molecular Formula | C19H22O7 |
| Molecular Weight | 362.38 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | (1S,2S,4S,5S,7R,8R,9S,11S,13S)-8-hydroxy-7-(2-hydroxyethyl)-1-methyl-3,6,10,16-tetraoxaheptacyclo[11.7.0.02,4.02,9.05,7.09,11.014,18]icos-14(18)-en-17-one |
| SMILES | C[C@]12CCC3=C(COC3=O)[C@@H]1C[C@@H]1O[C@@]13[C@H](O)[C@@]1(CCO)O[C@H]1[C@@H]1O[C@@]132 |
| InChI | InChI=1S/C19H22O7/c1-16-3-2-8-9(7-23-14(8)21)10(16)6-11-18(24-11)15(22)17(4-5-20)12(25-17)13-19(16,18)26-13/h10-13,15,20,22H,2-7H2,1H3/t10-,11-,12-,13-,15+,16-,17-,18+,19+/m0/s1 |
| InChIKey | BIOXXUACYDACSZ-AFTYLFDZSA-N |
| XLogP | -0.17 |
| TPSA | 104.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.38 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|