About N-(2-hydroxypropyl)-5-methyl-1,2-oxazole-4-sulfonamide
N-(2-hydroxypropyl)-5-methyl-1,2-oxazole-4-sulfonamide (PubChem CID 122695917) has the molecular formula C7H12N2O4S
and a molecular weight of 220.25 g/mol. Its IUPAC name is N-(2-hydroxypropyl)-5-methyl-1,2-oxazole-4-sulfonamide.
Molecular Properties
| Compound Name | N-(2-hydroxypropyl)-5-methyl-1,2-oxazole-4-sulfonamide |
| PubChem CID | 122695917 |
| Molecular Formula | C7H12N2O4S |
| Molecular Weight | 220.25 g/mol |
| Exact Mass | 220.05 |
| IUPAC Name | N-(2-hydroxypropyl)-5-methyl-1,2-oxazole-4-sulfonamide |
| SMILES | Cc1oncc1S(=O)(=O)NCC(C)O |
| InChI | InChI=1S/C7H12N2O4S/c1-5(10)3-9-14(11,12)7-4-8-13-6(7)2/h4-5,9-10H,3H2,1-2H3 |
| InChIKey | KEGJNUWRIIKXBG-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.25 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(2-hydroxypropyl)-5-methyl-1,2-oxazole-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-hydroxypropyl)-5-methyl-1,2-oxazole-4-sulfonamide?
The IUPAC name of N-(2-hydroxypropyl)-5-methyl-1,2-oxazole-4-sulfonamide (CID 122695917) is N-(2-hydroxypropyl)-5-methyl-1,2-oxazole-4-sulfonamide.
What is the SMILES notation for N-(2-hydroxypropyl)-5-methyl-1,2-oxazole-4-sulfonamide?
The canonical SMILES for N-(2-hydroxypropyl)-5-methyl-1,2-oxazole-4-sulfonamide is Cc1oncc1S(=O)(=O)NCC(C)O.
What is the InChIKey of N-(2-hydroxypropyl)-5-methyl-1,2-oxazole-4-sulfonamide?
The InChIKey is KEGJNUWRIIKXBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2O4S/c1-5(10)3-9-14(11,12)7-4-8-13-6(7)2/h4-5,9-10H,3H2,1-2H3.
What are the key properties of N-(2-hydroxypropyl)-5-methyl-1,2-oxazole-4-sulfonamide?
N-(2-hydroxypropyl)-5-methyl-1,2-oxazole-4-sulfonamide has a molecular weight of 220.25 g/mol, XLogP of -0.36, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-hydroxypropyl)-5-methyl-1,2-oxazole-4-sulfonamide is sourced from PubChem (CID 122695917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).