C12H17F3O — CID 122696450
(3Z)-5-methylidene-9-(2,2,2-trifluoroethoxy)nona-1,3-diene (PubChem CID 122696450) has the molecular formula C12H17F3O and a molecular weight of 234.26 g/mol. Its IUPAC name is (3Z)-5-methylidene-9-(2,2,2-trifluoroethoxy)nona-1,3-diene.
| Compound Name | (3Z)-5-methylidene-9-(2,2,2-trifluoroethoxy)nona-1,3-diene |
|---|---|
| PubChem CID | 122696450 |
| Molecular Formula | C12H17F3O |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | (3Z)-5-methylidene-9-(2,2,2-trifluoroethoxy)nona-1,3-diene |
| SMILES | C=C/C=C\C(=C)CCCCOCC(F)(F)F |
| InChI | InChI=1S/C12H17F3O/c1-3-4-7-11(2)8-5-6-9-16-10-12(13,14)15/h3-4,7H,1-2,5-6,8-10H2/b7-4- |
| InChIKey | JSHNEZVHRIYIIL-DAXSKMNVSA-N |
| XLogP | 4.03 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|