C19H14Cl2O2 — CID 122696622
(E)-3-(6,10-dichloro-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2(7),3,5,9(14),10,12-hexaenyl)prop-2-enoic acid (PubChem CID 122696622) has the molecular formula C19H14Cl2O2 and a molecular weight of 345.23 g/mol. Its IUPAC name is (E)-3-(6,10-dichloro-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2(7),3,5,9(14),10,12-hexaenyl)prop-2-enoic acid.
| Compound Name | (E)-3-(6,10-dichloro-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2(7),3,5,9(14),10,12-hexaenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 122696622 |
| Molecular Formula | C19H14Cl2O2 |
| Molecular Weight | 345.23 g/mol |
| Exact Mass | 344.04 |
| IUPAC Name | (E)-3-(6,10-dichloro-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2(7),3,5,9(14),10,12-hexaenyl)prop-2-enoic acid |
| SMILES | O=C(O)/C=C/C1CC2c3c(Cl)cccc3C1c1cccc(Cl)c12 |
| InChI | InChI=1S/C19H14Cl2O2/c20-14-5-1-3-11-17-10(7-8-16(22)23)9-13(18(11)14)19-12(17)4-2-6-15(19)21/h1-8,10,13,17H,9H2,(H,22,23)/b8-7+ |
| InChIKey | MRTYMSDCAIDJAD-BQYQJAHWSA-N |
| XLogP | 5.23 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.23 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|