About 1-propan-2-yl-6,7-dihydro-5H-pyrano[2,3-d]pyrazole
1-propan-2-yl-6,7-dihydro-5H-pyrano[2,3-d]pyrazole (PubChem CID 122696776) has the molecular formula C9H14N2O
and a molecular weight of 166.22 g/mol. Its IUPAC name is 1-propan-2-yl-6,7-dihydro-5H-pyrano[2,3-d]pyrazole.
Molecular Properties
| Compound Name | 1-propan-2-yl-6,7-dihydro-5H-pyrano[2,3-d]pyrazole |
| PubChem CID | 122696776 |
| Molecular Formula | C9H14N2O |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.11 |
| IUPAC Name | 1-propan-2-yl-6,7-dihydro-5H-pyrano[2,3-d]pyrazole |
| SMILES | CC(C)n1ncc2c1CCCO2 |
| InChI | InChI=1S/C9H14N2O/c1-7(2)11-8-4-3-5-12-9(8)6-10-11/h6-7H,3-5H2,1-2H3 |
| InChIKey | OSPVEFLLCUOSHL-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-propan-2-yl-6,7-dihydro-5H-pyrano[2,3-d]pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-propan-2-yl-6,7-dihydro-5H-pyrano[2,3-d]pyrazole?
The IUPAC name of 1-propan-2-yl-6,7-dihydro-5H-pyrano[2,3-d]pyrazole (CID 122696776) is 1-propan-2-yl-6,7-dihydro-5H-pyrano[2,3-d]pyrazole.
What is the SMILES notation for 1-propan-2-yl-6,7-dihydro-5H-pyrano[2,3-d]pyrazole?
The canonical SMILES for 1-propan-2-yl-6,7-dihydro-5H-pyrano[2,3-d]pyrazole is CC(C)n1ncc2c1CCCO2.
What is the InChIKey of 1-propan-2-yl-6,7-dihydro-5H-pyrano[2,3-d]pyrazole?
The InChIKey is OSPVEFLLCUOSHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O/c1-7(2)11-8-4-3-5-12-9(8)6-10-11/h6-7H,3-5H2,1-2H3.
What are the key properties of 1-propan-2-yl-6,7-dihydro-5H-pyrano[2,3-d]pyrazole?
1-propan-2-yl-6,7-dihydro-5H-pyrano[2,3-d]pyrazole has a molecular weight of 166.22 g/mol, XLogP of 1.79, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-propan-2-yl-6,7-dihydro-5H-pyrano[2,3-d]pyrazole is sourced from PubChem (CID 122696776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).