C20H20N4O5S — CID 1226968
4-[[1-(3,4-dimethylphenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]-3-methylbenzenesulfonamide (PubChem CID 1226968) has the molecular formula C20H20N4O5S and a molecular weight of 428.47 g/mol. Its IUPAC name is 4-[[1-(3,4-dimethylphenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]-3-methylbenzenesulfonamide.
| Compound Name | 4-[[1-(3,4-dimethylphenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]-3-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 1226968 |
| Molecular Formula | C20H20N4O5S |
| Molecular Weight | 428.47 g/mol |
| Exact Mass | 428.12 |
| IUPAC Name | 4-[[1-(3,4-dimethylphenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]-3-methylbenzenesulfonamide |
| SMILES | Cc1ccc(-n2c(O)c(/C=N/c3ccc(S(N)(=O)=O)cc3C)c(=O)[nH]c2=O)cc1C |
| InChI | InChI=1S/C20H20N4O5S/c1-11-4-5-14(8-12(11)2)24-19(26)16(18(25)23-20(24)27)10-22-17-7-6-15(9-13(17)3)30(21,28)29/h4-10,26H,1-3H3,(H2,21,28,29)(H,23,25,27)/b22-10+ |
| InChIKey | FSTRJHQBNRGGIV-LSHDLFTRSA-N |
| XLogP | 1.55 |
| TPSA | 147.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.47 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|