About 3-propan-2-yl-[1,3]oxazolo[4,5-c]pyridin-2-one
3-propan-2-yl-[1,3]oxazolo[4,5-c]pyridin-2-one (PubChem CID 122696847) has the molecular formula C9H10N2O2
and a molecular weight of 178.19 g/mol. Its IUPAC name is 3-propan-2-yl-[1,3]oxazolo[4,5-c]pyridin-2-one.
Molecular Properties
| Compound Name | 3-propan-2-yl-[1,3]oxazolo[4,5-c]pyridin-2-one |
| PubChem CID | 122696847 |
| Molecular Formula | C9H10N2O2 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.07 |
| IUPAC Name | 3-propan-2-yl-[1,3]oxazolo[4,5-c]pyridin-2-one |
| SMILES | CC(C)n1c(=O)oc2ccncc21 |
| InChI | InChI=1S/C9H10N2O2/c1-6(2)11-7-5-10-4-3-8(7)13-9(11)12/h3-6H,1-2H3 |
| InChIKey | IMKHACRGDCRGMV-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 48.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-propan-2-yl-[1,3]oxazolo[4,5-c]pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-propan-2-yl-[1,3]oxazolo[4,5-c]pyridin-2-one?
The IUPAC name of 3-propan-2-yl-[1,3]oxazolo[4,5-c]pyridin-2-one (CID 122696847) is 3-propan-2-yl-[1,3]oxazolo[4,5-c]pyridin-2-one.
What is the SMILES notation for 3-propan-2-yl-[1,3]oxazolo[4,5-c]pyridin-2-one?
The canonical SMILES for 3-propan-2-yl-[1,3]oxazolo[4,5-c]pyridin-2-one is CC(C)n1c(=O)oc2ccncc21.
What is the InChIKey of 3-propan-2-yl-[1,3]oxazolo[4,5-c]pyridin-2-one?
The InChIKey is IMKHACRGDCRGMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O2/c1-6(2)11-7-5-10-4-3-8(7)13-9(11)12/h3-6H,1-2H3.
What are the key properties of 3-propan-2-yl-[1,3]oxazolo[4,5-c]pyridin-2-one?
3-propan-2-yl-[1,3]oxazolo[4,5-c]pyridin-2-one has a molecular weight of 178.19 g/mol, XLogP of 1.57, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-propan-2-yl-[1,3]oxazolo[4,5-c]pyridin-2-one is sourced from PubChem (CID 122696847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).