About 5-ethyl-3H-[1,3]thiazolo[4,5-d]pyrimidin-2-one
5-ethyl-3H-[1,3]thiazolo[4,5-d]pyrimidin-2-one (PubChem CID 122697190) has the molecular formula C7H7N3OS
and a molecular weight of 181.22 g/mol. Its IUPAC name is 5-ethyl-3H-[1,3]thiazolo[4,5-d]pyrimidin-2-one.
Molecular Properties
| Compound Name | 5-ethyl-3H-[1,3]thiazolo[4,5-d]pyrimidin-2-one |
| PubChem CID | 122697190 |
| Molecular Formula | C7H7N3OS |
| Molecular Weight | 181.22 g/mol |
| Exact Mass | 181.03 |
| IUPAC Name | 5-ethyl-3H-[1,3]thiazolo[4,5-d]pyrimidin-2-one |
| SMILES | CCc1ncc2sc(=O)[nH]c2n1 |
| InChI | InChI=1S/C7H7N3OS/c1-2-5-8-3-4-6(9-5)10-7(11)12-4/h3H,2H2,1H3,(H,8,9,10,11) |
| InChIKey | HMUVZRDAOJTKIJ-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.22 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-ethyl-3H-[1,3]thiazolo[4,5-d]pyrimidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-3H-[1,3]thiazolo[4,5-d]pyrimidin-2-one?
The IUPAC name of 5-ethyl-3H-[1,3]thiazolo[4,5-d]pyrimidin-2-one (CID 122697190) is 5-ethyl-3H-[1,3]thiazolo[4,5-d]pyrimidin-2-one.
What is the SMILES notation for 5-ethyl-3H-[1,3]thiazolo[4,5-d]pyrimidin-2-one?
The canonical SMILES for 5-ethyl-3H-[1,3]thiazolo[4,5-d]pyrimidin-2-one is CCc1ncc2sc(=O)[nH]c2n1.
What is the InChIKey of 5-ethyl-3H-[1,3]thiazolo[4,5-d]pyrimidin-2-one?
The InChIKey is HMUVZRDAOJTKIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3OS/c1-2-5-8-3-4-6(9-5)10-7(11)12-4/h3H,2H2,1H3,(H,8,9,10,11).
What are the key properties of 5-ethyl-3H-[1,3]thiazolo[4,5-d]pyrimidin-2-one?
5-ethyl-3H-[1,3]thiazolo[4,5-d]pyrimidin-2-one has a molecular weight of 181.22 g/mol, XLogP of 0.94, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-3H-[1,3]thiazolo[4,5-d]pyrimidin-2-one is sourced from PubChem (CID 122697190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).