About 4-propan-2-yl-[1,3]oxazolo[4,5-d]pyridazine
4-propan-2-yl-[1,3]oxazolo[4,5-d]pyridazine (PubChem CID 122697307) has the molecular formula C8H9N3O
and a molecular weight of 163.18 g/mol. Its IUPAC name is 4-propan-2-yl-[1,3]oxazolo[4,5-d]pyridazine.
Molecular Properties
| Compound Name | 4-propan-2-yl-[1,3]oxazolo[4,5-d]pyridazine |
| PubChem CID | 122697307 |
| Molecular Formula | C8H9N3O |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.07 |
| IUPAC Name | 4-propan-2-yl-[1,3]oxazolo[4,5-d]pyridazine |
| SMILES | CC(C)c1nncc2ocnc12 |
| InChI | InChI=1S/C8H9N3O/c1-5(2)7-8-6(3-10-11-7)12-4-9-8/h3-5H,1-2H3 |
| InChIKey | XUDUEYOUZBMFKE-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-propan-2-yl-[1,3]oxazolo[4,5-d]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-propan-2-yl-[1,3]oxazolo[4,5-d]pyridazine?
The IUPAC name of 4-propan-2-yl-[1,3]oxazolo[4,5-d]pyridazine (CID 122697307) is 4-propan-2-yl-[1,3]oxazolo[4,5-d]pyridazine.
What is the SMILES notation for 4-propan-2-yl-[1,3]oxazolo[4,5-d]pyridazine?
The canonical SMILES for 4-propan-2-yl-[1,3]oxazolo[4,5-d]pyridazine is CC(C)c1nncc2ocnc12.
What is the InChIKey of 4-propan-2-yl-[1,3]oxazolo[4,5-d]pyridazine?
The InChIKey is XUDUEYOUZBMFKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3O/c1-5(2)7-8-6(3-10-11-7)12-4-9-8/h3-5H,1-2H3.
What are the key properties of 4-propan-2-yl-[1,3]oxazolo[4,5-d]pyridazine?
4-propan-2-yl-[1,3]oxazolo[4,5-d]pyridazine has a molecular weight of 163.18 g/mol, XLogP of 1.74, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-propan-2-yl-[1,3]oxazolo[4,5-d]pyridazine is sourced from PubChem (CID 122697307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).