C13H15NO — CID 122697906
10-methyl-6,7,8,9-tetrahydropyrido[1,2-a]indol-7-ol (PubChem CID 122697906) has the molecular formula C13H15NO and a molecular weight of 201.27 g/mol. Its IUPAC name is 10-methyl-6,7,8,9-tetrahydropyrido[1,2-a]indol-7-ol.
| Compound Name | 10-methyl-6,7,8,9-tetrahydropyrido[1,2-a]indol-7-ol |
|---|---|
| PubChem CID | 122697906 |
| Molecular Formula | C13H15NO |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.12 |
| IUPAC Name | 10-methyl-6,7,8,9-tetrahydropyrido[1,2-a]indol-7-ol |
| SMILES | Cc1c2n(c3ccccc13)CC(O)CC2 |
| InChI | InChI=1S/C13H15NO/c1-9-11-4-2-3-5-13(11)14-8-10(15)6-7-12(9)14/h2-5,10,15H,6-8H2,1H3 |
| InChIKey | VZVXTOTYGXHXPY-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|