About 2-[(2Z)-2-methylpenta-2,4-dienylidene]imidazole
2-[(2Z)-2-methylpenta-2,4-dienylidene]imidazole (PubChem CID 122697921) has the molecular formula C9H10N2
and a molecular weight of 146.19 g/mol. Its IUPAC name is 2-[(2Z)-2-methylpenta-2,4-dienylidene]imidazole.
Molecular Properties
| Compound Name | 2-[(2Z)-2-methylpenta-2,4-dienylidene]imidazole |
| PubChem CID | 122697921 |
| Molecular Formula | C9H10N2 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.08 |
| IUPAC Name | 2-[(2Z)-2-methylpenta-2,4-dienylidene]imidazole |
| SMILES | C=C/C=C(/C)C=C1N=CC=N1 |
| InChI | InChI=1S/C9H10N2/c1-3-4-8(2)7-9-10-5-6-11-9/h3-7H,1H2,2H3/b8-4- |
| InChIKey | FEGDVIPOAFJXLB-YWEYNIOJSA-N |
| XLogP | 2.12 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2Z)-2-methylpenta-2,4-dienylidene]imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2Z)-2-methylpenta-2,4-dienylidene]imidazole?
The IUPAC name of 2-[(2Z)-2-methylpenta-2,4-dienylidene]imidazole (CID 122697921) is 2-[(2Z)-2-methylpenta-2,4-dienylidene]imidazole.
What is the SMILES notation for 2-[(2Z)-2-methylpenta-2,4-dienylidene]imidazole?
The canonical SMILES for 2-[(2Z)-2-methylpenta-2,4-dienylidene]imidazole is C=C/C=C(/C)C=C1N=CC=N1.
What is the InChIKey of 2-[(2Z)-2-methylpenta-2,4-dienylidene]imidazole?
The InChIKey is FEGDVIPOAFJXLB-YWEYNIOJSA-N. The full InChI is InChI=1S/C9H10N2/c1-3-4-8(2)7-9-10-5-6-11-9/h3-7H,1H2,2H3/b8-4-.
What are the key properties of 2-[(2Z)-2-methylpenta-2,4-dienylidene]imidazole?
2-[(2Z)-2-methylpenta-2,4-dienylidene]imidazole has a molecular weight of 146.19 g/mol, XLogP of 2.12, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2Z)-2-methylpenta-2,4-dienylidene]imidazole is sourced from PubChem (CID 122697921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).