C18H20F2N4O3 — CID 122697970
2,2-difluoro-N-[2-[5-[2-(1-methylpyrazol-3-yl)oxyethoxy]-1H-indol-3-yl]ethyl]acetamide (PubChem CID 122697970) has the molecular formula C18H20F2N4O3 and a molecular weight of 378.38 g/mol. Its IUPAC name is 2,2-difluoro-N-[2-[5-[2-(1-methylpyrazol-3-yl)oxyethoxy]-1H-indol-3-yl]ethyl]acetamide.
| Compound Name | 2,2-difluoro-N-[2-[5-[2-(1-methylpyrazol-3-yl)oxyethoxy]-1H-indol-3-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 122697970 |
| Molecular Formula | C18H20F2N4O3 |
| Molecular Weight | 378.38 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | 2,2-difluoro-N-[2-[5-[2-(1-methylpyrazol-3-yl)oxyethoxy]-1H-indol-3-yl]ethyl]acetamide |
| SMILES | Cn1ccc(OCCOc2ccc3[nH]cc(CCNC(=O)C(F)F)c3c2)n1 |
| InChI | InChI=1S/C18H20F2N4O3/c1-24-7-5-16(23-24)27-9-8-26-13-2-3-15-14(10-13)12(11-22-15)4-6-21-18(25)17(19)20/h2-3,5,7,10-11,17,22H,4,6,8-9H2,1H3,(H,21,25) |
| InChIKey | OZFWUNRGUVXHKI-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 81.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.38 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|