C22H36FN2O12P — CID 122698141
[2,2-dimethylpropanoyloxymethoxy-[[(2R,3R,4R,5R)-4-fluoro-3-hydroxy-5-(6-hydroxy-2-oxo-1,6-dihydropyrimidin-3-yl)-2-methyloxolan-2-yl]methoxy]phosphoryl]oxymethyl 2,2-dimethylpropanoate (PubChem CID 122698141) has the molecular formula C22H36FN2O12P and a molecular weight of 570.50 g/mol. Its IUPAC name is [2,2-dimethylpropanoyloxymethoxy-[[(2R,3R,4R,5R)-4-fluoro-3-hydroxy-5-(6-hydroxy-2-oxo-1,6-dihydropyrimidin-3-yl)-2-methyloxolan-2-yl]methoxy]phosphoryl]oxymethyl 2,2-dimethylpropanoate.
| Compound Name | [2,2-dimethylpropanoyloxymethoxy-[[(2R,3R,4R,5R)-4-fluoro-3-hydroxy-5-(6-hydroxy-2-oxo-1,6-dihydropyrimidin-3-yl)-2-methyloxolan-2-yl]methoxy]phosphoryl]oxymethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 122698141 |
| Molecular Formula | C22H36FN2O12P |
| Molecular Weight | 570.50 g/mol |
| Exact Mass | 570.20 |
| IUPAC Name | [2,2-dimethylpropanoyloxymethoxy-[[(2R,3R,4R,5R)-4-fluoro-3-hydroxy-5-(6-hydroxy-2-oxo-1,6-dihydropyrimidin-3-yl)-2-methyloxolan-2-yl]methoxy]phosphoryl]oxymethyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OCOP(=O)(OCOC(=O)C(C)(C)C)OC[C@@]1(C)O[C@@H](N2C=CC(O)NC2=O)[C@H](F)[C@@H]1O |
| InChI | InChI=1S/C22H36FN2O12P/c1-20(2,3)17(28)32-11-35-38(31,36-12-33-18(29)21(4,5)6)34-10-22(7)15(27)14(23)16(37-22)25-9-8-13(26)24-19(25)30/h8-9,13-16,26-27H,10-12H2,1-7H3,(H,24,30)/t13?,14-,15+,16-,22-/m1/s1 |
| InChIKey | HPGOMWLMNLTXIY-LSKLOBMBSA-N |
| XLogP | 1.91 |
| TPSA | 179.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.50 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|