C30H37N3O7 — CID 122699029
5-(2,5-dimethoxyphenyl)-N-[[[(2R)-2-[[formyl(phenylmethoxy)amino]methyl]heptanoyl]amino]methyl]furan-2-carboxamide (PubChem CID 122699029) has the molecular formula C30H37N3O7 and a molecular weight of 551.64 g/mol. Its IUPAC name is 5-(2,5-dimethoxyphenyl)-N-[[[(2R)-2-[[formyl(phenylmethoxy)amino]methyl]heptanoyl]amino]methyl]furan-2-carboxamide.
| Compound Name | 5-(2,5-dimethoxyphenyl)-N-[[[(2R)-2-[[formyl(phenylmethoxy)amino]methyl]heptanoyl]amino]methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 122699029 |
| Molecular Formula | C30H37N3O7 |
| Molecular Weight | 551.64 g/mol |
| Exact Mass | 551.26 |
| IUPAC Name | 5-(2,5-dimethoxyphenyl)-N-[[[(2R)-2-[[formyl(phenylmethoxy)amino]methyl]heptanoyl]amino]methyl]furan-2-carboxamide |
| SMILES | CCCCC[C@H](CN(C=O)OCc1ccccc1)C(=O)NCNC(=O)c1ccc(-c2cc(OC)ccc2OC)o1 |
| InChI | InChI=1S/C30H37N3O7/c1-4-5-7-12-23(18-33(21-34)39-19-22-10-8-6-9-11-22)29(35)31-20-32-30(36)28-16-15-27(40-28)25-17-24(37-2)13-14-26(25)38-3/h6,8-11,13-17,21,23H,4-5,7,12,18-20H2,1-3H3,(H,31,35)(H,32,36)/t23-/m1/s1 |
| InChIKey | PWADXCNYJKROHR-HSZRJFAPSA-N |
| XLogP | 4.55 |
| TPSA | 119.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.64 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|