About 1-[(4R)-4-benzyl-1,3-oxazolidin-3-yl]-4-naphthalen-2-ylbutan-1-one
1-[(4R)-4-benzyl-1,3-oxazolidin-3-yl]-4-naphthalen-2-ylbutan-1-one (PubChem CID 122699064) has the molecular formula C24H25NO2
and a molecular weight of 359.47 g/mol. Its IUPAC name is 1-[(4R)-4-benzyl-1,3-oxazolidin-3-yl]-4-naphthalen-2-ylbutan-1-one.
Molecular Properties
| Compound Name | 1-[(4R)-4-benzyl-1,3-oxazolidin-3-yl]-4-naphthalen-2-ylbutan-1-one |
| PubChem CID | 122699064 |
| Molecular Formula | C24H25NO2 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.19 |
| IUPAC Name | 1-[(4R)-4-benzyl-1,3-oxazolidin-3-yl]-4-naphthalen-2-ylbutan-1-one |
| SMILES | O=C(CCCc1ccc2ccccc2c1)N1COC[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C24H25NO2/c26-24(25-18-27-17-23(25)16-19-7-2-1-3-8-19)12-6-9-20-13-14-21-10-4-5-11-22(21)15-20/h1-5,7-8,10-11,13-15,23H,6,9,12,16-18H2/t23-/m1/s1 |
| InChIKey | NRERIOQVQAEUPC-HSZRJFAPSA-N |
| XLogP | 4.59 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[(4R)-4-benzyl-1,3-oxazolidin-3-yl]-4-naphthalen-2-ylbutan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4R)-4-benzyl-1,3-oxazolidin-3-yl]-4-naphthalen-2-ylbutan-1-one?
The IUPAC name of 1-[(4R)-4-benzyl-1,3-oxazolidin-3-yl]-4-naphthalen-2-ylbutan-1-one (CID 122699064) is 1-[(4R)-4-benzyl-1,3-oxazolidin-3-yl]-4-naphthalen-2-ylbutan-1-one.
What is the SMILES notation for 1-[(4R)-4-benzyl-1,3-oxazolidin-3-yl]-4-naphthalen-2-ylbutan-1-one?
The canonical SMILES for 1-[(4R)-4-benzyl-1,3-oxazolidin-3-yl]-4-naphthalen-2-ylbutan-1-one is O=C(CCCc1ccc2ccccc2c1)N1COC[C@H]1Cc1ccccc1.
What is the InChIKey of 1-[(4R)-4-benzyl-1,3-oxazolidin-3-yl]-4-naphthalen-2-ylbutan-1-one?
The InChIKey is NRERIOQVQAEUPC-HSZRJFAPSA-N. The full InChI is InChI=1S/C24H25NO2/c26-24(25-18-27-17-23(25)16-19-7-2-1-3-8-19)12-6-9-20-13-14-21-10-4-5-11-22(21)15-20/h1-5,7-8,10-11,13-15,23H,6,9,12,16-18H2/t23-/m1/s1.
What are the key properties of 1-[(4R)-4-benzyl-1,3-oxazolidin-3-yl]-4-naphthalen-2-ylbutan-1-one?
1-[(4R)-4-benzyl-1,3-oxazolidin-3-yl]-4-naphthalen-2-ylbutan-1-one has a molecular weight of 359.47 g/mol, XLogP of 4.59, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4R)-4-benzyl-1,3-oxazolidin-3-yl]-4-naphthalen-2-ylbutan-1-one is sourced from PubChem (CID 122699064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).