About 3-butylthioxanthen-9-one
3-butylthioxanthen-9-one (PubChem CID 122699511) has the molecular formula C17H16OS
and a molecular weight of 268.38 g/mol. Its IUPAC name is 3-butylthioxanthen-9-one.
Molecular Properties
| Compound Name | 3-butylthioxanthen-9-one |
| PubChem CID | 122699511 |
| Molecular Formula | C17H16OS |
| Molecular Weight | 268.38 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | 3-butylthioxanthen-9-one |
| SMILES | CCCCc1ccc2c(=O)c3ccccc3sc2c1 |
| InChI | InChI=1S/C17H16OS/c1-2-3-6-12-9-10-14-16(11-12)19-15-8-5-4-7-13(15)17(14)18/h4-5,7-11H,2-3,6H2,1H3 |
| InChIKey | BQOFEBAEMYGRQG-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.38 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 3-butylthioxanthen-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butylthioxanthen-9-one?
The IUPAC name of 3-butylthioxanthen-9-one (CID 122699511) is 3-butylthioxanthen-9-one.
What is the SMILES notation for 3-butylthioxanthen-9-one?
The canonical SMILES for 3-butylthioxanthen-9-one is CCCCc1ccc2c(=O)c3ccccc3sc2c1.
What is the InChIKey of 3-butylthioxanthen-9-one?
The InChIKey is BQOFEBAEMYGRQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16OS/c1-2-3-6-12-9-10-14-16(11-12)19-15-8-5-4-7-13(15)17(14)18/h4-5,7-11H,2-3,6H2,1H3.
What are the key properties of 3-butylthioxanthen-9-one?
3-butylthioxanthen-9-one has a molecular weight of 268.38 g/mol, XLogP of 4.76, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butylthioxanthen-9-one is sourced from PubChem (CID 122699511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).