About N,N'-ditert-butyl-3-[2-(tert-butylamino)ethyl]pentane-1,5-diamine
N,N'-ditert-butyl-3-[2-(tert-butylamino)ethyl]pentane-1,5-diamine (PubChem CID 122700767) has the molecular formula C19H43N3
and a molecular weight of 313.57 g/mol. Its IUPAC name is N,N'-ditert-butyl-3-[2-(tert-butylamino)ethyl]pentane-1,5-diamine.
Molecular Properties
| Compound Name | N,N'-ditert-butyl-3-[2-(tert-butylamino)ethyl]pentane-1,5-diamine |
| PubChem CID | 122700767 |
| Molecular Formula | C19H43N3 |
| Molecular Weight | 313.57 g/mol |
| Exact Mass | 313.35 |
| IUPAC Name | N,N'-ditert-butyl-3-[2-(tert-butylamino)ethyl]pentane-1,5-diamine |
| SMILES | CC(C)(C)NCCC(CCNC(C)(C)C)CCNC(C)(C)C |
| InChI | InChI=1S/C19H43N3/c1-17(2,3)20-13-10-16(11-14-21-18(4,5)6)12-15-22-19(7,8)9/h16,20-22H,10-15H2,1-9H3 |
| InChIKey | KEWRMIMDRHLNNR-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.57 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N,N'-ditert-butyl-3-[2-(tert-butylamino)ethyl]pentane-1,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N'-ditert-butyl-3-[2-(tert-butylamino)ethyl]pentane-1,5-diamine?
The IUPAC name of N,N'-ditert-butyl-3-[2-(tert-butylamino)ethyl]pentane-1,5-diamine (CID 122700767) is N,N'-ditert-butyl-3-[2-(tert-butylamino)ethyl]pentane-1,5-diamine.
What is the SMILES notation for N,N'-ditert-butyl-3-[2-(tert-butylamino)ethyl]pentane-1,5-diamine?
The canonical SMILES for N,N'-ditert-butyl-3-[2-(tert-butylamino)ethyl]pentane-1,5-diamine is CC(C)(C)NCCC(CCNC(C)(C)C)CCNC(C)(C)C.
What is the InChIKey of N,N'-ditert-butyl-3-[2-(tert-butylamino)ethyl]pentane-1,5-diamine?
The InChIKey is KEWRMIMDRHLNNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H43N3/c1-17(2,3)20-13-10-16(11-14-21-18(4,5)6)12-15-22-19(7,8)9/h16,20-22H,10-15H2,1-9H3.
What are the key properties of N,N'-ditert-butyl-3-[2-(tert-butylamino)ethyl]pentane-1,5-diamine?
N,N'-ditert-butyl-3-[2-(tert-butylamino)ethyl]pentane-1,5-diamine has a molecular weight of 313.57 g/mol, XLogP of 3.94, 9 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N'-ditert-butyl-3-[2-(tert-butylamino)ethyl]pentane-1,5-diamine is sourced from PubChem (CID 122700767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).