C32H33F7N2O5 — CID 122700955
5-[(3R,4S)-1-[(3R,6S)-6-[6,8-bis(trifluoromethyl)-2,4-dihydro-1,3-benzoxazine-3-carbonyl]-6-cyclopropyloxan-3-yl]-3-methylpiperidin-4-yl]-2-fluorobenzoic acid (PubChem CID 122700955) has the molecular formula C32H33F7N2O5 and a molecular weight of 658.61 g/mol. Its IUPAC name is 5-[(3R,4S)-1-[(3R,6S)-6-[6,8-bis(trifluoromethyl)-2,4-dihydro-1,3-benzoxazine-3-carbonyl]-6-cyclopropyloxan-3-yl]-3-methylpiperidin-4-yl]-2-fluorobenzoic acid.
| Compound Name | 5-[(3R,4S)-1-[(3R,6S)-6-[6,8-bis(trifluoromethyl)-2,4-dihydro-1,3-benzoxazine-3-carbonyl]-6-cyclopropyloxan-3-yl]-3-methylpiperidin-4-yl]-2-fluorobenzoic acid |
|---|---|
| PubChem CID | 122700955 |
| Molecular Formula | C32H33F7N2O5 |
| Molecular Weight | 658.61 g/mol |
| Exact Mass | 658.23 |
| IUPAC Name | 5-[(3R,4S)-1-[(3R,6S)-6-[6,8-bis(trifluoromethyl)-2,4-dihydro-1,3-benzoxazine-3-carbonyl]-6-cyclopropyloxan-3-yl]-3-methylpiperidin-4-yl]-2-fluorobenzoic acid |
| SMILES | C[C@H]1CN([C@@H]2CC[C@@](C(=O)N3COc4c(cc(C(F)(F)F)cc4C(F)(F)F)C3)(C3CC3)OC2)CC[C@@H]1c1ccc(F)c(C(=O)O)c1 |
| InChI | InChI=1S/C32H33F7N2O5/c1-17-13-40(9-7-23(17)18-2-5-26(33)24(11-18)28(42)43)22-6-8-30(46-15-22,20-3-4-20)29(44)41-14-19-10-21(31(34,35)36)12-25(32(37,38)39)27(19)45-16-41/h2,5,10-12,17,20,22-23H,3-4,6-9,13-16H2,1H3,(H,42,43)/t17-,22+,23-,30-/m0/s1 |
| InChIKey | CVUWXOZTPCFTIL-ZZSUFPKNSA-N |
| XLogP | 6.69 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.61 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |